You want to buy a tent in the shape of a pyramid. The rectangular base is 35 square feet, with a height of 4 feet. What is the volume of the tent? Round your answer to the nearest hundredth.

Answers

Answer 1

Answer:

46.67 cubic feet

Step-by-step explanation:

The formula for volume of a pyramid is

V = (1/3)Bh      where B is the area of the base, and h is the height.

We are givne B = 35 and h = 4.  Plug those values in and simplify...

V = (1/3)(35)(4)

 

  V = (1/3)(140)

       V = 140/3

             V = 46 2/3 cubic feet, which is 46.666667, or 46.67 rounded to the nearest hundredth

Answer 2

Answer:

46.67 cubic feet

Step-by-step explanation:


Related Questions

Jenelle has a piece of wire that is 0.30 feet long. She needs 2.5 times that length to hang a painting. What length of wire does she need

Answers

Answer:

She needs 0,75 ft of wire

Step-by-step explanation:

Hello

She needs (0.30 ft)*(2.5) = 0,75

Best regards

Two cyclists, Alan and Brian, are racing around oval track of length 450m on the same direction simultaneously from the same point. Alan races around the track in 45 seconds before Brian does and overtakes him every 9 minutes. What are their rates, in meters per minute?

Answers

Answer:

Alan: 200 m/min

Brian: 150 m/min

Step-by-step explanation:    

Given : Two cyclists, Alan and Brian, are racing around oval track of length 450m on the same direction simultaneously from the same point. Alan races around the track in 45 seconds before Brian does and overtakes him every 9 minutes.

To find : What are their rates, in meters per minute?

Solution :

Let n represent the number of laps that Alan completes in 9 minutes.

Then n-1 is the number of laps Brian completes.

45 seconds = 3/4 minutes.

The difference in their lap times in minutes per lap is

[tex]\frac{9}{(n -1)}-\frac{9}{n} =\frac{3}{4}[/tex]

Solving the equation we get,

[tex]\frac{9n-9n+9}{n(n -1)} =\frac{3}{4}[/tex]

[tex]9\times 4=3\times n(n -1)[/tex]

[tex]36=3\times n(n -1)[/tex]

[tex]n^2-n-12=0[/tex]

[tex]n^2-4n+3n-12=0[/tex]

[tex]n(n-4)+3(n-4)=0[/tex]

[tex](n-4)(n+3)=0[/tex]

[tex]n=4,-3[/tex]

Neglecting n=-3

So, n=4

Then Alan's speed in m/min is

[tex]S=\frac{D}{T}[/tex]

[tex]S_a=\frac{4\times 450}{9}[/tex]

[tex]S_a=200 m/min[/tex]

Brian completes 3 laps in that 9-minute time, so his rate is

[tex]S_b=\frac{3\times 450}{9}[/tex]

[tex]S_b=150 m/min[/tex]

Therefore, Alan: 200 m/min

Brian: 150 m/min

A swimming pool is 6 meters wide and 10 meters long. Which fraction compares the pool's width to the pool's length?

10/6

5/3

3/2

5/2

Answers

10/6 is the answer.

Answer:

simplified form would be 3/2.

Step-by-step explanation:

?????????????????????????

Answers

6 pounds.



First, find the amount she spent. 70 - 18.88 = 51.12

Now, just divide 51.12 by the cost per pound. 51.12 / 8.52 = 6

So, Karen purchased 6 pounds of coffee.



Please consider marking this answer as Brainliest to help me advance.

stan bought a new tire for his carand paid $85 plus tax. if the tax rate is 8.5%, how much tax did stan pay?​

Answers

if the tax rate is 8.5% stan payed $7.22

Answer:

Stan paid $7.23 in tax

Step-by-step explanation:

8.5/100=t/85

85•8.5=100t

722.5=100t

722.5/100=t

7.225=t

Please help me answer this question. I dont understand any of this.. I will mark brainliest.

Answers

Answer:

A = 77.32

Step-by-step explanation:

Since this is a right triangle we can use trigonometric functions

sin  = opposite side/ hypotenuse

sin A =  80/82

sin A =40/41

Take the inverse sin of each side

sin^-1 (sin A ) =sin ^-1 (40/41)

A =77.31961651

Rounding to the nearest hundredth

A = 77.32

Answer:

77.32°

Step-by-step explanation:

Using cosine law:

80² = 18² + 82² - 2(18)(82)cos

cosA = 9/41

A = 77.31961651°

Fencing a garden is area right

Answers

Fencing a garden would be Perimeter because your trying to find how much fencing you would need so you can surround the garden.

The area of the garden is how much space there is. Ex. 5ft×9.5ft=47.5ft² . The 5ft would be the length of the garden, and the 9.5ft would be the width. But to find area, you would need to do L×W, or 5ft×9.5ft in this case for area.

But to find Perimeter, you need to do L+L+W+W. If we use the numbers from before for the area example, you would be doing 5ft+5ft+9.5ft+9.5ft, you would be getting 29ft.

If you want the definitions to better understand this, here they are:

Perimeter: the total distance around the edge of the figure.

Area: the number of unit squares that can be contained within it.(hence the reason "²" was at the end of the total in the example for area I provided.)

The rectangle below has a total perimeter of 100 ft:


rectangle with width of 9


Which of the following equations can be used to determine the length of the longer side of the rectangle?

x + 9 = 100
2x + 18 = 100
9x = 100
81x = 100

Answers

Answer:

B) 2x + 18 = 100

Step-by-step explanation:

Given: Perimeter = 100 feet and width = 9 ft

We know that the perimeter of a rectangle = 2(length + width)

Let "x" be the length of the rectangle.

Plugging in the given values in the above formula, we get

100 = 2(x + 9)

On the right hand side, we can use the distributive property a(b + c) = ab + ac

and expand.

100 = 2x + 2*9

100 = 2x + 18

This is same as 2x + 18 = 100

Therefore, the answer is B) 2x + 18 = 100

Plz help me i need it

Answers

Answer:   [tex]\bold{c)\quad f^{-1}(x)=\dfrac{ln(x)}{2}}[/tex]

Step-by-step explanation:

Inverse is when you swap the x's and y's and solve for y. Note: f(x) is y

[tex]y=e^{2x}\\\\\text{Swap the x's and y's:}\\x=e^{2y}\\\\\text{Apply ln to both sides:}\\ln\ x=ln\ e^{2y}\\\\\text{ln e cancels out}\\ln\ x=2y\\\\\text{Divide both sides by 2:}\\\dfrac{ln\ x}{2}=y[/tex]

In a right triangle that has one acute angle of 18 degrees, cos 18 degrees is congruent to ?

Answers

Answer:

cos(18°)=sin(72°)

Step-by-step explanation:

we know that

In a right triangle

cos(A)=sin(B)

If A and B are complementary angles

so

A+B=90°

In this problem

A=18°

B=90-18=72°

therefore

cos(18°)=sin(72°)

I only have 5 minutes to answer please help!!

Florian ran 1.2 miles and walked 4.8 laps around the path at the park for a total distance of 3.6 miles. Which shows the correct equation and value of x, the distance of 1 lap around the path at the park?

3.6x + 1.2 = 4.8; x = 1 mile
4.8x + 1.2 = 3.6; x = 1 mile
3.6x + 1.2 = 4.8; x = 0.5 mile
4.8x + 1.2 = 3.6; x = 0.5 mile

Answers

Answer:

The answer is D

Step-by-step explanation:

4.8 times 0.5 equals 2.4+ 1.2 = 3.6 which is the total number of miles he ran/walked

Hope it helped!

Which of the following best describes the solution to the system of equations below?
4x + 5y = 7
8x + 10y = 14

A. The system of equations has infinitely many solutions.

B. The system of equations has exactly one solution where x = 7/4 and y = 0

C. The system of equations has no solution.

D. The system of equations has exactly one solution where x = 1 and y = 6/5

Answers

Final answer:

The given system of equations has equivalent equations, hence it has infinitely many solutions. The best answer to the question is option A.

Explanation:

The system of equations presented in the question is:

4x + 5y = 7

8x + 10y = 14

These two equations are equivalent, meaning they are different forms of the same equation. This is because the second equation is just the first one multiplied by 2. When two or more equations are equivalent in a system, it means that they intersect at infinitely many points, hence they have infinitely many solutions. Therefore, the best description for the solution to this system of equations is option A: The system has infinitely many solutions.

Learn more about Equivalent Systems of Equations

#SPJ12

Final answer:

As per the values, C. the system of equations has no solution.

Explanation:

To determine the solution to the system of equations, we can solve the equations using the method of elimination.

First, we can multiply the first equation by 2 to make the coefficients of x in both equations the same. This gives us the equations 8x + 10y = 14 and 8x + 10y = 7.

Subtracting these equations, we get 0 = 7 - 14, or 0 = -7.

Since this is not a true statement, the system of equations has no solution.

Therefore, the correct answer is C. The system of equations has no solution.

Learn more about System of Equations here:

https://brainly.com/question/21620502

#SPJ12

use a absolute value to write a rule for determining the distance between two points on a coordinate plane that have the same x-coordinate​

Answers

Answer:

For two points (x,a) and (x,b), the distance would be |a-b| or |b-a| both would be the same.

Step-by-step explanation:

What is the rule without an absolute value?  basically we are looking for the difference (which is the answer to a subtraction problem) between the two.

Say the two points are (x,a) and (x,b)  So they have the same x value but different y values.  Now, when you want to take the difference you usually want to subtract the smaller number from the larger, but hat happens if you don't?  So instead subtract the larger number from the smaller number?  I'm gonna show a few examples.

7-5 = 2

5 - 7 = -2

7 - 3 = 4

3 - 7 = -4

As you can see, no matter which order you subtract you will always get the same number, just either positive of negative.  We are going to use that.  Basically, we can have the two in either order, as long as we have them inside of an absolute value, we will always get the same answer.

so, for our two y values, a and b, it doesn't matter which is larger |a-b| = |b-a| and this is the distance.  

Final answer:

The distance between two points that have the same x-coordinate on a coordinate plane can be calculated by taking the absolute difference of their y-coordinates. This calculation will always yield a positive value, reflecting the fact that distance is a scalar quantity.

Explanation:

The distance between two points with the same x-coordinate on a coordinate plane (i.e., two points on a vertical line) can be determined using absolute value. If these points have y-coordinates of y1 and y2, the distance between them (d) is the absolute difference of their y-coordinates. Mathematically, this is expressed as:

d = |y2 - y1|

Here, the symbol '|' surrounding the difference represents the absolute value, which makes any negative result positive. For example, if we have points A(3, 4) and B(3, 1), using our rule, the distance between these points would be |1 - 4| = |-3| = 3 units.

This absolute value method ensures that the distance is always a positive number, regardless of whether y2 is bigger than y1 or not. This essentially reflects the basic principle of distance being a scalar (having only magnitude but not direction).

Learn more about Distance between two points on a coordinate plane here:https://brainly.com/question/32829538#SPJ11

Is F(x)= X^2(X^2+9)(X^3+2X) even or odd

Answers

Answer:

The function is odd.

Step-by-step explanation:

A function is even if the graph of the function is symmetric with respect to the y-axis. A function is odd if the graph of the function is symmetric with respect to the origin. To find if the function is even or odd, we're going to graph the function using DESMOS.

As you can see in the attached picture, the function is symmetric with respect to the origin. Therefore, the function is odd.

what is x^2=7x

number 9

Answers

Let's do this in steps, show your work!

#1. We need to move all terms to one side.

x^2 - 7x = 0

#2. Then factor out the common term x.

x(x - 7) = 0.

#3. Simplify to get..

x = 0, 7.

If you need help with any other question let me know.

HELP ASAP! GIVING BRAINLIEST!!

Which triangle is a reflection of triangle ABC over the x-axis?

A) DEF

B) GHI

C) JKL

D) MNO

Answers

Answer:

D) MNO

Step-by-step explanation:

A) and B) are over the y axis

C) is over both axes

D) is correct: it is a reflection over the x axis.

Answer:

The answer is D

Step-by-step explanation:

What is the quotient?

Answers

Answer: FIRST OPTION

Step-by-step explanation:

According the quotient of powers property, when you have the division of two powers with the same base, then you must subtract the exponents.

Therefore, keeping the property above on mind, you have that the quotient is the shown below:

[tex]\frac{(-7)^2}{(-7)^{-1}}=(-7)^{(2-(-1))}=(-7)^{(2+1)}=(-7)^3=-343[/tex]

What is the value of y in the equation y − 7 = 21? (4 points)

Select one:
a. 7
b. 17
c. 21
d. 28

Answers

Answer:

D. 21

Step-by-step explanation:

28-21=7

28-7=21

C. 21


28-21=7

So that’s your answer

A rectangular prism has a volume of 189cm^3. The height of the prism is 3cm. What are the dimensions of the base

Answers

Answer:

l = 9 cm

b = 7 cm

h = 3 cm

Step-by-step explanation:

Formula:-

Volume of cuboid = lbh

l - Length of cuboid

b - breadth of cuboid

h - Height of cuboid

To find the dimensions of prism

Here prism is like a cuboid.

Volume of prism = 189 cm^3

Height h = 3 cm

Volume = lbg

189 = l * b* 3

l * b = 189/3 = 63 = 9 * 7

Therefore l and b may be 9 and 7





What is the approximate measure of angle T in the triangle below?

Answers

Answer:

[tex]T=79\degree[/tex]

Step-by-step explanation:

Recall and use the cosine rule to find the approximate value of angle T.

[tex]|SU|^2=|ST|^2+|TU|^2-2(|ST|)(|TU|)\cos T[/tex]

We plug in the values of the side lengths to obtain;

[tex]4.3^2=3.9^2+2.7^2-2(3.9)(2.7)\cos T[/tex]

[tex]18.49=15.21+7.29-21.06\cos T[/tex]

[tex]18.49=22.5-21.06\cos T[/tex]

[tex]18.49-22.5=-21.06\cos T[/tex]

[tex]-4.01=-21.06\cos T[/tex]

[tex]4.01=21.06\cos T[/tex]

[tex]\frac{4.01}{21.06}=\cos T[/tex]

[tex]0.1904=\cos T[/tex]

[tex]T=\cos^{-1}(0.1904)[/tex]

[tex]T=79.02[/tex]

Angle T is approximately 79 degrees.

If p is true and q is false, then p v q is true. True or false

Answers

Answer:

TRUE

Step-by-step explanation:

Given statement is "If p is true and q is false, then p v q is true".

Now we need to decide if the given statement is True or false

By definition of "p v q" , also read as "p OR q", we know that if any of p or q is true then value of "p v q" is always true.

Given that p is true then "p v q" must be true.

Whch is same as conclusion of the given statement.

Hence final answer is "TRUE".

Answer:

TRUE

Step-by-step explanation:

Given statement is "If p is true and q is false, then p v q is true".

Now we need to decide if the given statement is True or false

By definition of "p v q" , also read as "p OR q", we know that if any of p or q is true then value of "p v q" is always true.

Given that p is true then "p v q" must be true.

Whch is same as conclusion of the given statement.

Hence final answer is "TRUE".

Jorge has 40 one inch cubes. What are 2 different ways that he can stack the cubes to make a rectangular prism?

Answers

20x2 this means that 20 times two equals 40

What is the equation to represent the graph (4,5)

Answers

Answer:

  |x-4| +|y-5|=0

Step-by-step explanation:

There are many equations that will graph as the point (x, y) = (4, 5). One of them is ...

|x-4| +|y-5| = 0

Betsy is buying topsoil for the flower bed shown below.

One bag of topsoil covers 20 square meters.

How many bags of topsoil does Betsy need to cover her flower bed?

A 2 bags
B 3 bags
C 4 bags
D 5 bags

Answers

Answer:

Option B. 3 bags

Step-by-step explanation:

step 1

Find the area of the flower bed

The area of the flower bed is the area of a triangle

A=(1/2)bh=(1/2)(20)(6)=60 m^2

step 2

Divide the area by 20 square meters to find the number of bags of topsoil

(60)/(20)=3 bags

Answer:

B. 3 Bags

Step-by-step explanation:

PLEASE HELP!!!!!!

Find the number of ways in which 9 people can be divided into 2 groups: the first group has 5 people and the second group has 4 people.

Answers

1. group 1: 4 people: group 2: 5 people
2. group 1: 6 people group 2: 3 people
3. group 1: 3 people group 2: 6 people
4. group 1: 2 people group 2: 7 people
5. group 1: 7 people group 2: 2 people
6. group 1: 8 people group 2: 1 person
7. group 1: 1 person group 2: 8 people
8. group 1: 9 people group 2; 0 people
9. group 1 : no people group 2: 9 people

need help asap!!!!!!!!!!!!!!!!

Answers

Answer:

22 sq. cm

Step-by-step explanation:

liam deposits $2400 into an account that earns 8.3% interest compounded quarterly. how much money will liam have in 5 years.

Answers

Answer:

Total = 2,400 * (1 + (.083/4))^4*5

Total = 2,400 * (1.02075)^20

Total = 2,400 * 1.5079528829

Total = 3,619.09

Step-by-step explanation:

Answer:

$3,619.09

Step-by-step explanation:

liam deposits $2400 into an account that earns 8.3% interest compounded quarterly.

Compound interest formula is

[tex]A= P(1+ \frac{r}{n} )^{n*t}[/tex]

where A is the final amount

P is the initial amount deposited

r is the rate of interest

n is the compounding period

t is the time in years

P= 2400, r= 8.3%= 0.083, t=5, n=4 (quarterly)

Plug in all the values

[tex]A= 2400(1+ \frac{0.083}{4} )^{4*5}[/tex]

A= 3619.09

dovon answered 23, out of 25 problems on a math test correctly what percent of the problems did devon answerbcorrectly​

Answers

92%. 23 divided by 25 is .92 pretty much meaning he got a 92 on that math test (A-)

Devon answered 92% of the problems that were applied on test correctly.

What is percentage?

Percentage is a way of expressing a proportion or a fraction as a portion of 100. It is commonly used to compare quantities, indicate relative amounts, or express the part-to-whole relationship.

The term "percent" originates from the Latin phrase "per centum," meaning "by the hundred." It is represented by the symbol "%".

We know that;

Percent = Correct answers/Total answers * 100/1

= 23/25 * 100/1

92%

Learn more about percentage:https://brainly.com/question/32197511

#SPJ6

Azul has 4 green picks and no orange picks. You add orange picks so that there are 2 orange picks for every 1 green pick. How many picks are there now?

Answers

Answer:

12 picks total

Step-by-step explanation:

1. multiply 2 (orange picks) by 4 (green picks)

    2*4=8 total orange picks

2. add green picks (4) + orange picks (8)

    4+8=12

Credit unions are not subject to federal regulations. A. True B. False

Answers

Answer:

The correct answer is (FALSE)

Step-by-step explanation:

(APEX)

Final answer:

The statement is false. Credit Unions are subject to federal regulations and are overseen by the National Credit Union Administration (NCUA) in the United States.

Explanation:

The statement, 'Credit unions are not subject to federal regulations,' is False. Credit unions, like other financial institutions, must adhere to several federal regulations. The National Credit Union Administration (NCUA) is the federal agency that charters and supervises federal credit unions in the United States. Among other duties, it's their role to administer the National Credit Union Share Insurance Fund (NCUSIF), which provides deposit insurance for credit union members, much like the FDIC does for bank customers.

Learn more about Credit Unions and Federal Regulations here:

https://brainly.com/question/34889840

#SPJ3

Other Questions
What is measure of angle R?Enter your answer as a decimal in the box. Round only your final answer to the nearest hundredth.P Q R is a right triangle. Q is a right angle. P Q is equal to five centimeters, Q R is equal to twelve centimeters and P R is equal to thirteen centimeters. Two large influences on the development of English words were Consider the following balanced equation. SiO2(s)+3C(s)SiC(s)+2CO(g) Complete the following table, showing the appropriate number of moles of reactants and products. If the number of moles of a reactant is provided, fill in the required amount of the other reactant, as well as the moles of each product formed. If the number of moles of a product is provided, fill in the required amount of each reactant to make that amount of product, as well as the amount of the other product that is made. molSiO2 molC molSiC molCO _____ 9 _____ _____ 1 _____ _____ _____ _____ _____ _____ 26 _____ 7.5 _____ _____ 1.4 _____ _____ _____ Part A Complete the first row. The ancient romans created a number of pictorial stained glass pieces Solving Rational Equations. LCD Method. Show work.[tex]\frac{3}{5x} + \frac{7}{2x} =1[/tex] Is "someone else asked me if my family ate dogs every day or only once in a while" is an example of a hyperbole I have no clue how to do this If 2/3x-1=4,then x=A)15/2B)8/2C)13/3D)10/3 Which of the following is NOT a key component of stretching?a. breathe deeply and regularlyb. hold each stretch for at least 15 secondsc. move quickly, completing as many stretches as you can in a 5-minute periodd. always use controlled motion Find the length of segment BA.A) 163.3B) 128.6C) 84.7D) 59.8 simplify the trigonometric expression. show your work please hurryWhat is the surface area of the cylinder? Express the answer in terms of pi. Keeping long-term customers is more beneficial than continually acquiring new customers because: What is the purpose of a monologue? A. To share a speakers Thoughs without other characters hearing. B. To disclose a speakers thoughts quietly with another character. C. To express a speakers innermost thoughts only to himself or herself. D. To reveal a speakers thoughts to the audience or other characters. Axel draws a cladogram containing a zebra, bear, lion, and tiger. He uses the physical appearances of the animals to decide where they should be placed in his cladogram. Is he correct? Why or why not? The technique of action painting was used by artists of which postWorld War II art movement? The sum of the digits of a two-digit number is 11. The tens digit is one less than three times the ones digit. Find the original number. How did this map change following the Treaty of Washington in 1846? (70 points) The Oregon Country was divided between Britain and the United States at the 49th Parallel. The Oregon Country was split into the Washington and Oregon Territories using the 49th Parallel as the new boundary.The boundary between the Oregon Country and Mexico was shifted from the 42nd Parallel to the Oregon Trail route.The portion of the Oregon Country below the 49th Parallel became part of Mexico, while the portion above the 49th Parallel became part of Great Britain. In Spanish, the verb ______ is used to tell how someone feels or where a person or thing is located. U.S. and Global Economics:Governments have the ability to use a person's private property for its own purposes but must compensate the person monetarily. This power is referred to asA.) Due processB.) Eminent domainC.) Implied powers D.) Delegated powers