Answer:
One reason why many common names are not always useful to biologists is because "They can apply to more than one animal," since terms like "cat" and "dog" refer to large families of animals, not specific ones.
where do the respiratory and circulatory systems meet?
Answer:
B
Explanation:
Select the words that correctly complete the statement.
_____ is an example of optimal health. To gain optimal health, the first step is to ______
1 ) the absence of disease
1) a high protein diet
1) sufficient sleep
1) taking a variety of vitamins and mineral supplements
1) the perfect body
2) eat healthy
2) establish practical goals
2) establish priorities
2) establish realistic goals
2) improve intellectual health
The absence of disease is an example of optimal health. To gain optimal health, the first step is to eat healthy.
According to the question;
We are required to select the words that correctly complete the statement.For the first blank space;
A very good indicator of optimal health is; The absence of disease.For the second blank space:
To gain optimal health, it is pertinent that one eats healthy.Read more:
https://brainly.com/question/20519649
Which part of a cell carries the genetic material? Cell membrane Cell wall Chloroplast Nucleus
Answer:
nucleus carries the genetic material
Which statement about natural selection is true?
A.
Natural selection and evolution are two terms for the same phenomenon.
B.
Natural selection is an outdated theory to explain how evolution took place.
C.
Natural selection is the process by which organisms with more beneficial traits are more likely to survive and reproduce.
D.
Natural selection is the process by which organisms develop variation in traits, which gives them a better chance of survival.
The answer is C. Natural selection is about ones traits being better than another’s which allow it to survive in the wilds longer.
Answer:
C.
Natural selection is the process by which organisms with more beneficial traits are more likely to survive and reproduce
Explanation:
Natural selection is a driving force for evolution that operates of genetic variations. The individuals with beneficial genetic traits are able to survive and reproduce more as compared to the other individuals with no beneficial traits.
This differential reproductive and survival rate of organisms due to adaptive genetic traits is called natural selection.
This is the amino acid cysteine. Circle the amine group, put a box around
the carboxylic acid group and use a different colored pencil/pen to circle the side
chain (R group).
H O
| ||
NH2— C- C-OH
|
CH2
|
SH
The amine group in cysteine is NH₂ found on the left side of the molecule. The carboxylic acid group is COOH found on the right side of the molecule. The R group or side chain in cysteine is CH₂-SH.
Explanation:The amine group in an amino acid is the part of the molecule that contains nitrogen (NH₂). In the case of cysteine, this would be on the left side of the molecule. You can circle this part. The carboxylic acid group is the part of the molecule that contains a carbon atom double-bonded to an oxygen atom and also bonded to a hydroxyl group (C-OH). In cysteine, this would be towards the right side of the central carbon. You can put a box around this. The R group, or side chain, is different for each different amino acid. For cysteine, this is composed of a carbon atom bonded to a sulfhydryl group (CH₂-SH). You can use a different color to circle this part.
Learn more about Amino acid groups here:https://brainly.com/question/33427968
#SPJ2
11. What's a recharge area?
A. The part of an aquifer where groundwater meets a lake or stream
B. The part of an aquifer where surface water reaches the water table
C. The part of an aquifer that's located between two aquicludes
D. The part of an aquifer that's located at a lower elevation
Answer:
B. The part of an aquifer where surface water reaches the water table
Explanation:
The recharge area of an aquifer, is the area where the aquifer comes in touch with the surface water. At this area, the aquifer is receiving new and fresh water reserves from the surface, thus replenishing the water that it has lost. Most of this water comes from the rainfall and runoff, though rivers and streams can also contribute to it. The recharging of the aquifer is crucial for its existence, as it constantly loses water, and the recharging in giving back water to it, thus balancing the lost and gained water in it.
Answer:
B
Explanation:
explain the concept of conservation of natural resources
Answer:
The Earth's natural resources include air, water, soil, minerals, fuels, plants, and animals. Conservation is the practice of caring for these resources so all living things can benefit from them now and in the future.
Answer:
he or she is right
Explanation:
New generations are better suited to their environment than the first generation. What is this called?
Answer:
Descent with modification
Explanation:
We define evolution as descent with modification from a common ancestor.
Evolution only occurs when there is a change in gene frequency within a population over time. These genetic differences are hereditary and can be passed on to the next generation - which is what really matters in evolution: long-term change. In this process, the new generations are better suited to their environment than the first generation because of descent with genetic modification.
Final answer:
New generations are better suited to their environment than the first generation due to evolution by natural selection. Individuals with advantageous traits tend to survive, reproduce, and pass these traits to their offspring, leading to better adapted future generations.
Explanation:
The phenomenon where new generations are better suited to their environment than the first generation is known as evolution by natural selection. This process occurs because the members of a population have genetic variability, which results in some individuals having traits that give them a biological advantage in specific environmental conditions. These individuals are more likely to survive and reproduce, passing on these advantageous traits to their offspring. Over time, these traits become more common within the population, making future generations progressively better adapted to their environment.
The land biomes are named for their
A. Large animals?
B. Predominant vegetation
C. Average climate
D. Physical location
Predominant vegetation
When a scientist is conducting research about all the plants and wildlife in the Mojave Desert as well as the desert’s resources, such as water and soil, the scientist is studying
Answer:
ecosystem
Explanation:
In this case, we have a situation where the scientist is describing an ecosystem. The ecosystem represents all the living organisms (flora and fauna), their environment, and the interactions that they all have between each other. In this case, we have the plants and animals being described, thus the flora and fauna, as well as the water and soil, thus their environment, so we have description of an ecosystem, or more specifically, the desert ecosystem of the Mohave Desert.
Answer:
an ecosystem
Explanation:
Which step of the scientific method relies more heavily on newly collected data than on creativity and innovation?
drawing a conclusion
designing an experiment
solving a problem
formulating a question
Answer:
The best possible answer is: Drawing a conclusion.
Explanation:
in orde to write a conclusion report on an experiment you need the data collected from the experiment. Designing the experiment requires too much trial and error. formulating the question is purely a made up idea until tested. However, solving a problem depends on wether it is after the experiment or during. If it is after than you are most likely using information from the experiment, in this case it could be the right answser. If it is during then the it is about what you can do to fix something that went wrong in the experiment. I hope this helps you!
Match the following. 1. the process involving the division of the nucleus in a reproductive cell; responsible for genetic recombination meiosis 2. the process involving the division of the nucleus of a body cell ovum 3. the condition of having oogametes—gametes of different sizes and shapes; usually have eggs and sperm sexual reproduction 4. (pl. ova) the egg cell; a female gamete oogamy 5. the form of production of new individuals by two parents in which the offspring obtains half of its hereditary information from each parent mitosis 6. a small, flagellated male gamete that swims to the egg to fertilize it sperm
Answer:
1. Meiosis: The process involving the division of the nucleus in a reproductive cell...
2. Mitosis: the process involving the division of the nucleus of a body cell
3. Oogamy: the condition of having oogametes...
4. Ovum: the egg cell...
5. Sexual Reproduction: the form of production of new individuals by two parents....
6. Sperm: a small flagellated male gamete...
Explanation:
1. Meiosis is a type of cell division that produces gametes, or reproductive cells. The process produces haploids, which have half the number of chromosomes as the parent. Genetic recombination occurs in meiosis, where there is an exchange of genetic information between the chromosomes, which bring about genetic diversity.
2. Mitosis is also a type of cell division, but unlike in meiosis, they produce clones of the parent cell. They produce diploids and this occurs in body cells. The purpose of mitosis is for growth, repair and asexual reproduction.
3. Oogamy is a form of sexual reproduction. What you would observe with oogamy is that one sex cell or "gamete" is bigger than the other gamete and the bigger gamete is non-motile or it can't move, while the other can. The egg cell for example is larger than the sperm cell, but it cannot move, while the sperm cell can.
4. The female gamete is called the ovum, plural form would be ova. This is also known as the egg cell. It is non-motile, so that means it cannot move. It's main purpose is to be fertilized by the sperm cell.
5. Sexual reproduction is the fusion of two gametes, which produces a fertilized egg, or a zygote. These gametes are haploid cells, which are produced in meiosis, and they each have half the genetic information of their parent cell. Thus the offspring produced will be genetically different from their parents.
6. The sperm cell is the male gamete. It has a flagella, which is like a tail that helps it move. It's main purpose is to fertilize an egg cell.
1.Meiosis
2.Mitosis
3.Oogamy
4.Ovum
5.Sexual Repoduction
6.Sperm
which of the following is the most likely outcome of global warming
Answer:
Ongoing effects include rising sea levels due to thermal expansion and melting of glaciers and ice sheets, and warming of the ocean surface, leading to increased temperature stratification. Other possible effects include large-scale changes in ocean circulation.
Explanation:
When a human or animal consumes food, the carbon in that food is most likely to be converted into which of the following elements?
a. carbon remains carbon
b. nitrogen
c. oxygen
d. hydrogen
Answer:
The answer is A
Answer:
a. Carbon remains carbon
Explanation:
Secondary pollutants are more harmful than primary pollutants.
The statement is generally true: secondary pollutants are often more harmful than primary pollutants.
Primary pollutants are substances that are directly released into the environment from human activities or natural sources. These pollutants include emissions from vehicles, industrial processes, and natural events like volcanic eruptions. While primary pollutants can have detrimental effects on human health and the environment, they are usually present in relatively high concentrations near their sources and can be easier to identify and control.
On the other hand, secondary pollutants are not directly emitted but are formed through chemical reactions involving primary pollutants and other atmospheric components. These reactions occur in the atmosphere under specific conditions, such as sunlight, temperature, and the presence of other reactive substances. Examples of secondary pollutants include ground-level ozone (formed from the reaction of nitrogen oxides and volatile organic compounds), smog, and some forms of particulate matter.
Secondary pollutants are often more harmful than primary pollutants for several reasons. Firstly, they can be present in lower concentrations, making them harder to detect and control. Their formation is dependent on specific atmospheric conditions, which can vary spatially and temporally, leading to localized and unpredictable exposure. Secondly, secondary pollutants can have more adverse health effects due to their chemical properties. For example, ground-level ozone is a strong respiratory irritant and can contribute to respiratory problems and other health issues. Thirdly, secondary pollutants can persist in the atmosphere for longer periods, leading to the potential for long-range transport and widespread impacts.
While the general statement holds true, it is important to note that the harm caused by pollutants depends on various factors, including their concentration, duration of exposure, individual susceptibility, and the specific pollutant in question. Nevertheless, the formation and presence of secondary pollutants can contribute significantly to the overall environmental and health risks associated with air pollution.
To learn more about pollutants, here
https://brainly.com/question/29594757
#SPJ6
Genes that come together with different alleles are called______.
heterozygous.
homozygous.
genotype.
segregated.
Answer:
Genes that come together with different alleles are called heterozygous. ( first choice)
A food web in a rain forest is shown below. Which of the following most likely occupies the location marked X in this food web?
A. decomposers
B. primary consumers
C. producers
D. secondary consumers
E. abiotic factors
Name any 3 methods of irrigation and briefly describe them.
Nutrients can also be provided through irrigation to the crops. The different sources of water for irrigation are wells, lakes, ponds, canals, tubewells and even dams.
What is irrigation?Irrigation is defined as the process of applying water to the crops artificially to realize their water requirements.
The three important methods of irrigation are sprinkler, surface, and drip/micro.
Water flows over the soil by gravitation force for surface irrigation. Sprinkler irrigation, also known as spray irrigation, is a means of dispensing water in a regulated manner, comparable to rainfall. Pumps, valves, pipes, and sprinklers may be used to disperse the water. Irrigation sprinklers can be used in a variety of settings, including residential, industrial, and agricultural.Drip irrigation entails laying tubing with emitters next to the plants on the ground. The emitters trickle water into the root zone of the soil slowly. Plant production and quality improve as moisture levels are maintained at an appropriate level.For more information regarding irrigation, visit:
https://brainly.com/question/903241
#SPJ2
Give examples of selective advantage of organism’s body part/organ
Answer:
The characteristic of an organism that enables it to survive and reproduce better than other organisms in a population in a given environment; the basis for evolution by natural selection.
Explanation:
Halogens are destructive to ozone because they are highly reactive with oxygen. Please select the best answer from the choices provided T F
Answer:
True
Explanation:
Halogens belongs to the seventh group on the periodic table. This group contains the most reactive set of elements that we have. They require just an electron to achieve a noble and stable electronic configuration.
When halogens mostly in form of ChloroFluoroCarbons(CFCs) reaches the atmoshpere, ultraviolet rays release chlorine atoms which easily breaks away an oxygen atom from ozone. Ozone thereby turns into an oxygen gas with two oxygen atoms instead of three. This reaction depletes the ozone layer.
which is an example of a decomposer?
A. Bear
B.Algae
C.Grass
D.Bacteria
Answer: D Bacteria
Answer:
D.Bacteria
Explanation:
A & B are primary producers
D is a secondary consumer
The answer is D. Bacteria.
Bacteria breaks down dead organisms, keeping our planet from being buried in dead organisms. Thus, bacteria bear and important task in being a decomposer.
Hope this helps!
What is the typical source of well water?
A. A holding tank
B. A discharge zone
C. A geyser
D. An aquifer
Answer:
an aquifer
Explanation:
Waianapanapa Beach in Hawaii is a black-sand beach that was formed by
waves crashing against volcanic rock. The sand can be very hot on sunny
days. Which statement best explains why?
O
A. The black sand has no heat capacity.
B. The black sand absorbs no radiation.
O
C. The black sand is immune to insolation.
D. The black sand has a low albedo.
Answer:
The black sand has a low albedo.- D.
Answer:
d
Explanation:
good luck
What is the most likely explanation for how speciation occurs
Answer:
when populations of a species that share the same habitat become reproductively isolated from each other.
Explanation:
Answer:
Natural selection is one explanation how speciation occurs.Explanation:
Natural selection is a key mechanism of evolution, in which survival and reproduction differences affects the evolution process.
It's important to say that Natural Selection is related with only phenotype's act, because it's due to environmental changes, adapting to those variables in order to survive.
ext ©
Introduction to Biology: Mastery Test
How is a scientific law different from a scientific theory?
OA.
A theory becomes a law after a long period of time has passed.
OB.
A theory is used for biology and chemistry and a law is used for physics.
HEEGES
U
C.
A theory is why something happens and a law is how something happens.
Co
Island
SA
BO
D.
A theory cannot be disproved but a law can be disproved.
nit
ES
A scientific law describes a generalized pattern in nature and is often expressed as a mathematical equation, while a scientific theory provides a comprehensive explanation for a group of related phenomena. Scientific laws describe what happens, and theories explain why and how it happens.
Explanation:The difference between a scientific law and a scientific theory is a fundamental aspect of scientific knowledge. A scientific law uses concise language to describe a generalized pattern in nature that is supported by scientific evidence and repeated experiments, often expressed in the form of a mathematical equation. In contrast, a scientific theory is a well-supported explanation of observations; it is more complex and dynamic, explaining a group of related phenomena rather than describing a single action. For instance, Newton's second law of motion, which can be summarized by the equation F = ma, is an example of a scientific law, while the Theory of Evolution is an example of a scientific theory.
Therefore, option C, stating that a theory is why something happens and a law is how something happens, accurately reflects the difference between a scientific law and a scientific theory. Scientific laws describe what happens under certain conditions in nature, often mathematically, while theories provide the explanation behind these observations, elaborating on why and how the phenomena occur.
Match the following items
1. Rr
2. rr
3. Identical alleles
4. Unlike alleles
5. RR
()homozygous, recessive
()homozygous definition
()heterozygous, dominant cell
()heterozygous definition
() homozygous, dominant cell
Answer:
2. homozygous, recessive
3. homozygous definition
1. heterozygous, dominant cell
4. heterozygous definition
5. homozygous, dominant cell
Explanation:
Which is a function of nucleic acids
Answer:
Nucleic acids are important because they make up genetic information in living things. There are two types of nucleic acid and they are DNA and RNA. DNA is the basic instructions for living things. It is passed down from parent to offspring and is found in the nucleus of the cell.
Explanation:
Answer:
store genetic information
Explanation:
Which organelles are found only in plant cells?
Answer:
c) cell wall , vacuole
Explanation:
When listing the levels of organization in organisms from smallest to most complex, which level is just below organs in
complexity?
Answer:
tissues
Explanation:
I hope this helps you.
The study of DNA provides evidence that all living things are related through
evolution by showing that all species
Answer:
it's d has the same genes
The answer is option B - The study of DNA provides evidence that all living things are related through evolution by showing that all species read the genetic code in the same way.
All species read the genetic code in the same way, indicating a common ancestry and supporting the theory of evolution.
The study of DNA provides substantial evidence that all species are related through evolution by showing that all species read the genetic code in the same way. This is apparent from the universal use of the same set of genetic instructions across different forms of life, demonstrating a common ancestry. By comparing genetic sequences, scientists have mapped out the relationships among various species, constructing what is known as the "tree of life."
This tool illustrates the connections between organisms, with many sharing significant genetic traits and DNA sequences, such as humans and chimpanzees sharing about 98% of their genes, indicating a recent common ancestor.