Final answer:
The correct answers are C) 1,500 centiliters (cL) and D) 150,000 milliliters (mL) because both equal 150 deciliters (dL) after conversion.
Explanation:
The student's question asks which of the following measurements is equal to 150 deciliters (dL): A) .015 dekaliters (daL), B) 0.15 liters (L), C) 1,500 centiliters (cL), or D) 150,000 milliliters (mL). Converting these options to deciliters will help us find the correct answer:
Option A: 0.015 daL is equal to 1.5 dL (because 1 daL = 10 dL).Option B: 0.15 L is equal to 15 dL (because 1 L = 10 dL).Option C: 1,500 cL is equal to 150 dL (because 1 cL = 0.1 dL).Option D: 150,000 mL is equal to 150 dL (because 1,000 mL = 1 L and 1 L = 10 dL).So, both options C and D are correct. They both equal 150 dL when converted.
Which of the following is an example of applied research? Determining the components of the human genome. Studying the behavior of gorillas when raising their offspring. Finding replacement chemicals for the air-polluting chlorofluorocarbons used in machines and appliances. Working with carbon to determine its bonding characteristics.
Answer:
Finding replacement chemicals for the air-polluting chlorofluorocarbons used in machines and appliances.
Explanation:
Applied research refers to research targeted at solving a specific problem in the society. Simply put, it is a research that focuses on bringing solution to practical problems in the society.
Chloroflourocarbons(CFCs) are known to cause damage to the ozone layer. Hence any research aimed at its substitution is targeted at solving a practical problem in the society hence it is an applied research.
For the quantum number lower case L = 0, how many possible values are there for the quantum number m subscrip l?
What is the value of in a spontaneous reaction?
a cylinder rod formed from silicon is 46.0cm long and has a mass of 3.10kg. The density of silicon is 2.33g/cm3. what is the diameter of the cylinder?
How does the amount of salt dissolve in water affect the density of water
Answer: How the amount of salt dissolve in water affect the density of water is the density of the water increases because the mass of the water increases.
Explanation:
. From left to right across a period in the periodic table, elements become less ___________ and more ______________ in their properties. 26. Francium has 36 isotopes, but only francium-223 occurs in nature. Francium-223 spontaneously emits particles and energy, so francium-223 is a(an) _____________ of francium. 27. At sea level, water ______________ at 100°C. 28. Cooking requires continuous addition of energy to the chemical reactions that are taking place. The chemical reactions involved in cooking can be described as __________________.
25. From left to right across a period in the periodic table, elements become less ___metalic________ and more _____nonmetalic _________ in their properties.
26. Francium has 36 isotopes, but only francium-223 occurs in nature. Francium-223 spontaneously emits particles and energy, so francium-223 is a(an) ______radioctiveistoop_______ of francium.
27. At sea level, water boils at 100°C.
28. Cooking requires continuous addition of energy to the chemical reactions that are taking place. The chemical reactions involved in cooking can be described as ______endothgermic____________.
29. The _______kinetic energy_________ theory of matter states that all particles of matter are in constant motion.
30. In Rutherford’s experiments, some of the _alpha particles____aimed at gold atoms bounced back, suggesting that a solid mass was at the center of the atom.
31. You are given the melting points of three unknown substances and are asked to predict which one is an ionic compound. You would select the compound with the ________highest________ melting point.
The phase change in which a substance changes from a liquid to a solid is A. freezing. B. melting. C. sublimation. D. condensation.
freezing. Think of what happens when you put water in the freezer
Select all of the answers that apply.
Which of the following are sources of biomass?
wood
the Sun
manure
water
paper
trash
food crops
The biomass is the plant or animal product or waste which is not used for eating or feeding and is used for generation of energy (in form of heat or other forms). so biomass if source of energy obtained from biological products.
In the given options
Wood : its waste can be used as biomass
Sun : it is the source of solar energy
Manure: it is decomposed product biological material used in agriculture
Water: it is not a source of energy directly
paper : it is also a product of wood but is not considered to be biomass
trash : it depends that what is present in trash and how it can be used
food crops: yes these are biomass
Answer:
I believe wood and food crops are the correct answers.
Calculate the standard free-energy change for the following reaction at 25 °C. Standard reduction potentials can be found here.
Since there are no given data for us to solve this problem, I will explain what a Standard Reduction Potential is. For example, if a student had an experiment and he wanted to know what is the most efficient and powerful redox reaction involving an uncommon combination of chemicals. The student would most likely record information in the Standard Reduction Potential that showed the voltage generated by the reaction in Aqueous Solution at 25 degrees Celsius and 1 atmosphere. This is a list of half reaction of ions in the solution at standard temperature and pressure.
What mass of iron is required to replace over from 8.00 g of silver nitrate dissolved in water
What conclusion can be made from Ernest Rutherford's the gold foil experiment
Which refers to the amount of a solute that will dissolve in a given volume of solvent at a given temperature and pressure
Answer:
The correct answer is solubility.
Explanation:
Solubility is illustrated as the maximum concentration of solute, which can be dissolved in a given amount of solvent at a specific pressure and temperature. Each solute exhibits a specific solubility. The solubility is generally articulated in the form of solute per 100 ml or grams or solvent, at a specific temperature and pressure.
Multiply the following numbers and write the answer in scientific notation: (3.45 × 107) × (6.25 × 105).
2.22 moles of HCl are dissolved in enough water to make 1.5 liters of solution.
Show work.
A. 1.0 M
B. 1.25 M
C. 1.5 M
D. 2.0 M
E. 2.5 M
To find the molarity of the HCl solution, divide the number of moles of HCl (2.22) by the volume of the solution (1.5 L), which results in a molarity of 1.48 M. This is rounded to 1.5 M to match the closest given answer option.
The question is asking you to calculate the molarity of the HCl solution when 2.22 moles of HCl are dissolved in 1.5 liters of water. Molarity (M) is defined as the number of moles of solute (in this case HCl) divided by the volume of the solution in liters. To calculate the molarity, follow these steps:
Write down the known values: moles of HCl (moles) = 2.22 moles, volume of solution (V) = 1.5 L.
Use the molarity formula: M = moles/V.
Calculate molarity: M = 2.22 moles / 1.5 L = 1.48 M.
Since molarity has to be reported to correct significant figures, and given options do not include 1.48 M, we round to the closest given option, which is 1.5 M (C).
1. Energy is expended when a force moves matter across a distance. True/False
2. The conservation of mass-energy and the first law of thermodynamics are synonymous. True/False
3. Temperature and thermal energy are synonymous terms. True/False
4. On the Kelvin scale, temperatures are expressed as positive values only. True/False
5. The amount of heat transfer required to change the temperature of one gram of water one degree Celsius is also known as a calorie. True/False
A scientist carries out an experiment how could she help other scientists judge the validity
of her results
The correct answer is B) let other scientists closely review her work.
A scientist carries out an experiment. She could help other scientists judge the validity of her results by letting other scientists closely review her work.
The scientist that has a discovery can have validation of its exériment if it allows other scientists to review its procedures, the methods, the results, and the way the scientists applied the scientific method during its research. This way the scientist can confirm that its work was good, valid, and can publish its conclusions in a scientific journal.
The other options of the question were A) use confusing language in her report, C) prevent others from seeing her data, and D) keep her experimental procedure a secret.
When Gerald mixes baking soda and vinegar, the materials combine to turn into a gas. What can Gerald assume occurred?
i am not explaining step by step so the answer is straight to the point. sorry i fyou wanted if an explanation.
THE ANSWER IS: A.) CHEMICAL CHANGE
When Gerald mixes baking soda and vinegar, the materials combine to turn into a gas. Its a type of chemical change.
What is chemical change?Chemical synthesis, and, alternatively, chemical breakdown into two or more separate molecules, occurs when one material reacts with another to create a new substance. These processes have been referred to as chemical change, and they are typically irreversible barring additional chemical reactions.
What is baking soda?The organic compounds sodium bicarbonate, also referred to as baking soda and bicarbonate of soda, have the formula [tex]NaHCO_{3}[/tex] . That is a salt made up of the cation sodium and the anion bicarbonate. Sodium bicarbonate ( [tex]NaHCO_{3}[/tex] ) would be a white, crystalline substance that frequently takes the form of a fine powder.
Now, it is found that when Gerald mixes baking soda and vinegar, the materials combine to turn into a gas is a kind of chemical change.
To know more about chemical change and baking soda
https://brainly.com/question/23693316
#SPJ2
Which of these is a major source of organic compounds? petroleum coal natural gas all of these
Answer: The correct answer is all of these.
Explanation:
Organic compounds are defined as the chemical compounds where one or more carbon atoms are covalently bonded to other atoms of hydrogen, oxygen or nitrogen.
They occur naturally in nature and the main sources of these organic compounds are petroleum, coal and natural gases.
Petroleum are the naturally occurring substances which contain organic compounds in the form of gases, liquid or semi-solid. Thus, they are a major source of organic compound.
Coal is also a form of fossil fuel which are the major source of organic compound.
Natural gas contains hydrocarbons and also is the major source of organic compounds.
Thus, the correct answer is all of these.
Which of the following values is equal to 1 micrometer?
A.) 0.000001 meter
B.) 0.001 meter
C.) 1,000 meter
D.) 1,000,000 meter
Answer : Option A) 0.000001 meter
Explanation : The value which will be equal to 1 micrometer will be 0.000001 meter.
As the conversion factor for 1 μm = [tex] 1 X 10^{-6} [/tex] m
So while converting micrometer to meter will be by converting micrometer to meter [tex] 1 X 10^{-6} [/tex] m in decimal it will be 0.000001 meter.
0.000001 meter is the measurement that equates to 1 micrometer. Hence option A is correct.
What is calibration in measurement?The process of calibrating a device involves comparing its measurement values to those of a calibration standard with known accuracy. A good example is one in the given option 0.000001 meter
Since accurate measurements are essential to the quality, safety, and innovation of the majority of the goods and services we use and rely on every day, calibration is crucial to ensure accurate measurements.
Learn more about calibration here:
https://brainly.com/question/525672
#SPJ6
Knowing the solubility of an unknown substance in water can help to identify what it is. true or false
TRUE. Knowing the solubility of an unknown substance in water can indeed help identify it, as different substances have various solubility levels and behaviours. Electrolytes, which dissolve to yield ions, their temperature dependency, and equilibrium conditions can give further hints to the substance's identity.
Explanation:The statement that knowing the solubility of an unknown substance in water can help to identify what it is, is true. Solubility can be defined as the maximum concentration of a substance that can be achieved under specified conditions in a solvent like water. Different substances have different levels of solubility, ranging from insoluble to sparingly soluble, to soluble and to miscible. Substances that dissolve to yield ions are called electrolytes, and their ionization when dissolved also varies, offering further clues to their identity. For example, soluble ionic substances and strong acids ionize completely and are strong electrolytes, while weak acids and bases ionize to a small extent and are weak electrolytes. Nonelectrolytes do not produce ions when dissolved in water. Also, considering the temperature dependency of solubility and the equilibrium conditions, we can identify the substance based on its solubility behavior.
Learn more about Solubility here:https://brainly.com/question/28170449
#SPJ3
Consider the reaction below. C2H4(g) + H2(g) to C2H6(g) Which change would likely cause the greatest increase in the rate of the reaction?
a decrease temperature and decrease pressure
b increase temperature and decrease pressure
c decrease temperature and increase pressure
d increase temperature and increase pressure
Answer: Option (d) is the correct answer.
Explanation:
In the given reaction, [tex]C_{2}H_{4}(g) + H_{2}(g) \rightarrow C_{2}H_{6}(g)[/tex] greatest increase in rate of reaction only occur when we increase the temperature and also increase the pressure.
This is because increase in pressure will bring the molecules closer to each other whereas increase in temperature will help in more number of collisions between reactant molecules.
Thus, this will lead to increase in formation of products. Hence, we can conclude that rate of reaction will increase with increase in temperature and increase in pressure.
if the burning of magnesium is incomplete how will this procedural error affect the reported mass of 1) magnesium in magnesium oxide ? explain 2) oxygen in magnesium oxide ? explain
An s sublevel is represented by the quantum number
which of the following must be cleaned and sanitized
Critical items must be sterile, semicritical items require a high level of disinfection, and noncritical items need to be clean but not highly disinfected.
The items that must be cleaning and sanitizing items include:
Critical items: These are items that will be used inside the body, such as surgical instruments, catheters, and intravenous fluids. They must be sterile.
Semicritical items: Examples of these items include gastrointestinal endoscopes and equipment for respiratory therapies.
They may contact mucous membranes or nonintact skin but do not penetrate tissues.
Semicritical items do not typically need to be sterilized but do require a high level of disinfection.
Noncritical items: These are items that may only contact intact skin. Examples include bed linens, furniture, crutches, stethoscopes, and blood pressure cuffs.
These items need to be clean but not highly disinfected.
Learn more about cleaning and sanitizing items here:
https://brainly.com/question/37905756
#SPJ2
In Part A, we saw that the theoretical yield of aluminum oxide is 0.800 mol . Calculate the percent yield if the actual yield of aluminum oxide is 0.456 mol .
Answer:
The percent yield is 58.12 %.
Explanation:
Theoretical yield of aluminum oxide = 0.800 mol
Theoretical amount of aluminum oxide = 0.800 mol × 102 g/mol = 81.6 g
Actual or experimental yield of aluminum oxide = 0.465 mol
Experimental amount of aluminum oxide = 0.465 mol × 102 g/mol = 47.43 g
[tex]\% yield=frac{\text{Experimental yield}}{\text{Actual yield}}\times 100[/tex]
[tex]\%=\frac{47.43 g}{81.6 g}\times 100=58.12\%[/tex]
The percent yield is 58.12 %.
a substance has a volume of 20mL and a density of 2.5 g/mL. what is it’s mass?
0.125 g
8 g
22.5 g
50 g
A substance has a volume of 20mL and a density of 2.5 g/mL. 50 grams is its mass. Option D is correct.
What is density?The density of a substance is the amount of substance present in pe unit volume in cubic centimeters in the area and it is the ratio of mass and the volume of the substance unit is a centimeter cube.
The volume of a substance is 20mL and the density of the substance 2.5 g/mL so, the mass will be
Density = mass/ volume
Substituting the value, Mass = density × Volume
Mass = 2.5 × 20
Mass = 50 grams.
Therefore, Option D is correct. A substance has a volume of 20mL and a density of 2.5 g/mL. 50 grams is its mass.
Learn more about density, here:
https://brainly.com/question/15164682
#SPJ2
Which element is most likely to bend without breaking?
Answer:
cobalt (Co) is the correct answer.
Explanation:
The is most likely to bend without breaking element is cobalt because of the following properties.
Cobalt is a ferromagnetic metal.Cobalt is a brittle and hard element.cobalt is not a nonmetal, it is a metal and metals are malleable and ductile means they can bend without breaking.Hence Cobalt in their solid form they can be easily bent and changed into thin films without breaking
What is the hydroxide concentration of a solution with a pH of 12.80?
Answer:
6.31 × 10^-2M
Explanation:
pH +pOH=14
14-12.80=1.20
10^-1.2=.0631
move the decimal two places to the right
=6.31 × 10^-2
Liquids and solids are referred to as “condensed phases” because the attractive forces are?
Explanation:
Condensed phase means that there is less space between the molecules of a matter. And a condensed phase do not compress easily so basically, they resist compression.
For example, solids and liquids are both condensed phases as there is less space between their particles and hence they are closer as compared to particles of a gaseous phase.
Though they have fixed volume but both of them are resistant to compression.
Therefore, we can conclude that liquids and solids are referred to as “condensed phases” because the attractive forces leave little space between the molecules.
what is the difference between cytokinesis and mitosis
Mitosis and cytokinesis are two processes in the cell division cycle. Mitosis refers to the division of the cell nucleus and occurs before cytokinesis. Cytokinesis is the final step that divides the cell into two separate daughter cells.
Explanation:Mitosis and cytokinesis are two crucial processes in the cell division cycle. Mitosis refers to the division of the nucleus, where the contents of the nucleus get divided equitably and distributed between its two halves. This process is divided into four major stages: prophase, metaphase, anaphase, and telophase.
Cytokinesis, however, occurs after mitosis and is the process that divides the cell's cytoplasm and body into two separate cells, becoming the final step in the cell division process. In animal cells, this usually begins during the late anaphase and involves a contractile ring composed of actin filaments. For plant cells, which have cell walls, the process is a bit different.
So basically, mitosis is the process by which the cell nucleus divides, whereas cytokinesis is the process that completes cell division by splitting the cell itself into two new cells.
Learn more about Mitosis vs Cytokinesis here:https://brainly.com/question/32897291
#SPJ12