what type of bond keeps each individual DNA strand together?

Answers

Answer 1
The type of bond that keeps each individual strand of DNA together is HYDROGEN BOND. The hydrogen bond involved a base from one strand and another base from the second strand, thus forming a complimentary pair. Individually, the hydrogen bonds are weak but collectively, they are quite strong.
Answer 2

Each DNA strand is held together internally by covalent bonds, while hydrogen bonds keep the two strands of the double helix joined, enabling them to unzip easily during DNA replication and repair.

The type of bond that keeps each individual DNA strand together is the covalent bond, which connects the sugar-phosphate backbone within each strand. Meanwhile, the two strands of the double helix of DNA are held together by hydrogen bonds. These hydrogen bonds are relatively weak, allowing the two strands to unzip during DNA replication, where each strand serves as a template for creating a new complementary strand.

The base pairing rules, Adenine (A) to Thymine (T) and Guanine (G) to Cytosine (C), are facilitated by these hydrogen bonds. Each base pair is connected by multiple hydrogen bonds - A and T by two hydrogen bonds, and G and C by three - to maintain the double helix structure of DNA.

In summary, the double-stranded structure of DNA is an artistic yet accurate portrayal of the hydrogen bonding holding the two strands together. This bond provides great strength when all are connected and allows for the necessary unzipping that occurs during DNA replication and repair processes.


Related Questions

During science class, while studying mixtures, you mix together table salt and sand. Your teacher challenges you to separate the salt from the sand. What property could you use and how would you use it? A) solubility; Add water to the mixture and dissolve the salt. B) density; The two will form two layers. Scoop out the top layer. C) color; Pick out one of the two solids by using color to guide you. D) particle size; Pour the mixture through a paper filter to separate the two.

Answers

The correct answer would be A) or the first option.
solubility, add water to the mixture and dissolve the salt
 

Katie needs to measure water for a recipe she is using to cook dinner. She should measure the liquid in . Katie also needs 4 fluid ounces of honey to make honey buns. The shortened form of fluid ounces is

Answers

fl. oz. 

Hope this helps.

Answer:

FL OZ, oz. fl.,  fl oz , fl.oz.

Explanation:

The acronym of Fluid Ounce is FL OZ. It is the standard unit of measurement of fluid volume.

Where FL represents the Fluid

And OZ represents the Ounce.

It can also be represented as oz. fl.,  fl oz , fl.oz.  etc.  

One cubic meter is equal to 33814.02 fl. oz. Two table spoons represents one fluid ounce which is equal to 1.040 oz.

Which rock cannot be found as a chemical sedimentary rock?

A. chert
B. limestone
C. sandstone
D. rock gypsum

Answers

A. Chert I believe so

The cerebellar ________ receives somatosensory information and influences the vestibulospinal and reticulospinal tracts. dentate nucleus pontine nucleus vermis flocculonodular node intermediate and lateral zones

Answers

The cerebellar vermis receives somatosensory information and influences the vestibulospinal and reticulospinal tracts.

How does the function of melanin explain not only the variety of skin colors but susceptibility to skin cancer?

Answers

The lack of melanin tends to correlate with a lighter skin color. However, it also correlates with a higher susceptibility to receiving a sunburn. The more often a person burns, the more likely it is that a person will be susceptible to skin cancers later on in life.

The function of melanin is providing variation in the skin colors. Also, provide protection from the harmful radiation that causes cancer.

Further Explanation:

Melanin is a pigment which is secreted by the melanocytes cells. They are present in the innermost layer of epidermis which is stratum basale. Melanin pigment is responsible for human hair color, skin color, and eyes color. Brown skin color has a high amount of melanin and white skin color have low level of melanin. Melanin has three different types  

Eumelanin Pheomelanin Neuromelanin

Eumelanin is mainly responsible for the dark skin and pheomelanin is accountable for the lighter skin color. Melanin is a pigment mainly present inside the skin; it mainly blocks the Ultra-Violet radiation from causing harmful effect in the DNA and also potentially causing skin cancer. If an individual has low level of melanin, then they are more prone to Ultraviolet rays. They can easily get sun burn. Also, they are more prone to cancer.

Learn more:

Learn more about mitosis  https://brainly.com/question/6462270 Learn more about the menstrual cycle https://brainly.com/question/723944 Learn more about meiosis https://brainly.com/question/94813

Answer Details:

Grade: High School

Subject: Health

Topic: Melanin pigment

Keywords:

Melanin pigment, eumelanin, pheomelanin, skin, DNA, cancer, ultra-violet rays, neuromelanin, white, dark, brown, eyes, skin, hair, color, pigment.

The amount of light entering the eye is regulated by the colored muscle known as the:

Answers

Answer:  "iris" .
__________________________________

Suppose you are studying coyotes and wolves, and you determine that wolves are experiencing a reduction in their population that can be attributed to a virus the coyotes carry that is more harmful in wolves. this is an example of

Answers

If one determines that wolves are experiencing a reduction in their population that can be attributed to a virus the coyotes carry that is more harmful in wolves. this is an example of apparent competition.

The fuel pellets are enriched only a few percent, rather than to 80–90%. name two reasons why.

Answers

Although fuel pellets are widely regarded as an efficient energy source,  they are not enriched by 80-90%. Two reasons are (1) fuel pellet is bulkier compared to other fuels, and 2) it needs boilers or bins which require regular cleaning to maintain fuel efficiency. 

Halaina is 11 years old and has just begun puberty. which glands will now begin to produce more estrogen as halaina begins to develop sexually? adrenal glands pancreas ovaries pituitary glands

Answers

The correct answer is:  [D]:  "pituitary glands" .
__________________________________________________

The troposphere is the layer of the atmosphere that...
Select one:
a. contains the ozone layer.
b. satellites fly in.
c. produces weather.
d. causes global warming.

Answers

C. Produces Weather. 
Hello There!

I'd say it is C. Produces weather.

Hope This Helps You!
Good Luck :) 

- Hannah ❤

Diffusion is defined as the movement from an area of high concentration to low concentration

TRUE OR FLASE?

Answers

True, Diffusion is defined as the movement from an area of high concentration to low concentration


hope this helps :D

This is in fact, TRUE.

Why do the cells in all living things need energy

Answers

They need it to surviveeeee
If thy didn't have energy they wouldn't be able to survive.

The diagram represents the _______ formula of glucose

Answers

The formula for glucose is C6H12O6

Why is water pollution a concern if water is continuously cycled through Earth’s systems?

Answers

Chemicals in the water rise up through the water process and spread over the Earth.

Why are fossils generally going to be more useful for studying animals that lived in or near water (e.g., streams, lakes, oceans, etc.)?
a. because all animals need water
b. because water is where most rocks form
c. because dead animals that fall into water are more likely to be in conditions that allow fossilization
d. because no decomposers are living in water
e. because the water prevents the organism from being eaten by scavengers?

Answers

The answer is:  [C]:
________________________________________________
"because dead animals that fall into water are more likely to be in conditions that allow fossilization" .
________________________________________________

the part of the brainstem that helps to coordinate movements is called the

Answers

It is the cerebellum’s duty to receive information from the sensory systems, the spinal chord, and other parts of the brain. After receiving all the information from those parts, the cerebellum will then regulate the motor movements. It is the work of the cerebellum to coordinate voluntary movements such as posture, balance, coordination, and speech, resulting in smooth and balanced muscular activity. It also has some roles such as storing learned sequence of movements,  participates in fine tuning and coordination of movements produced elsewhere in the brain and it integrates all of these things to produce movements. Because of the harmonious and fluid coordination of all the movements caused by the cerebellum, we are not even aware that we are doing those actions. The cerebellum is responsible and is important in learning and implementing of the motor skills.  

Final answer:

The cerebellum is the part of the brainstem responsible for coordinating body movements, located below the cerebrum and behind the brain stem.

Explanation:

The part of the brainstem that helps to coordinate movements is the cerebellum. The cerebellum is situated below the cerebrum and behind the brain stem. It plays a critical role in coordinating voluntary movements, balance, and posture. While the brainstem consists of the midbrain, the pons, and the medulla oblongata, the cerebellum works closely with these structures by integrating sensory input to fine-tune motor activity. The brainstem itself is essential for sensory and motor information integration and controls various vital functions such as breathing, blood pressure, and heart rate.

Logic structures are also called ____ structures.

Answers

Final answer:

Logic structures are also known as control structures and they dictate the flow of execution within a program, either through conditional statements, loops, or multi-case scenarios. Tree diagrams and logical constructs like boolean algebra similarly represent relationships in logic and electronics. Predicate logic further expands the intricate analysis of argument structures beyond material truth.

Explanation:

Logic structures are also called control structures. These structures determine the flow of control in a program's code. In programming, logical structures are crucial because they enable the conditional execution of code segments, such as executing a piece of code only if a certain condition is met (if-then-else statements), repeating a piece of code multiple times (loops like for and while), and ensuring that different cases are handled through switch or case statements.

These structures can be visually represented using various diagrams, one of them being a tree diagram. Tree diagrams are helpful in expressing relationships and hierarchies, reminiscent of the constituency in linguistics, where structures within a language are understood in terms of their parts' hierarchal arrangement. The notion of logical structures extends to boolean algebra and is found in digital circuits in electronics, as in the relationship between propositional logic and the corresponding circuit with batteries and switches.

In the context of logic and critical thinking, tree diagrams and tables assist in examining the formal validity of arguments, which depends on their internal logical structure rather than material truth. This is where predicate logic comes into play, allowing for the representation of subject-predicate relationships and enhancing the evaluation of arguments' formal structures.

When centric diatoms reproduce by simple cell division, the two new daughter cells are?

Answers

...are of unequal size.

Diatoms can reproduce either by sexual or asexual reproduction.
The asexual is the ordinary process and during the process of mitosis one of two new cells is smaller, while the other one is the same size of the parent cell.
The smaller cell will later  become normal sized because of the flexibility of the  walls or by sexual reproduction.

when the exponential phase of a logistic growth curve of the population ceases

A.the size of the population drops
B.the size of the population stays the same
C.population growth begins to slow down
D.population growth begins to speed up

Answers

C. population growth begins to slow down

give an example of a scientific investigation that would require both observations and experiments

Answers

put nectar into different colored containers but same size. put it outside and see how much nectar is left in each container is left

Adding fertilizers and pesticides on plants is an example of a scientific investigation that would require both observations and experiments.

What is an investigation?

Investigation can be defined as the first data which is collected after doing some research work.

It can be related to science or any other facts or data. It is about a careful examination of the data which is fact and to prove something.

In the scientific investigation related to plants, the need for fertilizers and pesticides is an example of scientific investigation. In this investigation person uses fertilizers or pesticides then they can seed the observation like they would not damage in the plant or create by any insect.

A person can investigate or gain data from the changes before using the insecticides and pesticides and after using them.

Learn more about investigation, here:

https://brainly.com/question/1191670

#SPJ2

disruption of which natural cycle most likely contributes to this temperature increase

Answers

Here I'm s your answer:

Well, Global warming plays a big part of mautral rule because of volcano's and factory's and cars Corbin dixode goes in the air and heats up the Earth more than it needs to causing death of many crops.

Your answer is
Global Warming

The cross of a green budgie and a yellow budgie produces offspring that are 12 green, 4 blue, 13 yellow, and 3 albino. what are the genotypes of the parents?

Answers

Final answer:

Determining the precise genotypes of the green and yellow budgie parents based on the given offspring ratios is challenging without a clear phenotype ratio or additional information on budgie genetics. However, in other organisms like pea plants, certain phenotype ratios can indicate heterozygosity in parents.

Explanation:

The phenotypic ratio of the offspring from the cross of a green budgie and a yellow budgie suggests complex genetic interactions. Green and yellow budgies likely have codominant or multiple allele interactions. The presence of green, blue, yellow, and albino offspring indicates that multiple genes are involved in determining the phenotype of these birds, not a simple dominant-recessive relationship. The albino phenotype suggests a recessive trait that is being masked when either of the color genes (green, blue, or yellow) is present in a dominant form. Let's focus on the green to yellow ratio to determine the parental genotypes. Given that the ratio of green to yellow offspring is not a clean 3:1 or 1:1 ratio, and includes other colors, we cannot be certain of the parents' genotypes without more information.

However, in pea plants, it's known that a test cross resulting in a 1:1 ratio of yellow to green offspring indicates that the parent is heterozygous. Similarly, crossing two heterozygous individuals can yield a phenotypic ratio of 3:1 for dominant to recessive traits, such as yellow to green seeds in pea plants. Unfortunately, without a clear phenotype ratio that matches these common genetic patterns, and without more information about budgie genetics, we cannot definitively determine the genotypes of the green and yellow budgie parents.

A rock falling through earth's atmosphere from outer space is called a ______.

Answers

A meteorites rock I believe so

the answer is meteor

Five weeks after conception, the developing organism is called a(n) _____.

Answers

Five weeks after conception, the developing organism is called an embryo
Zygote is the single cell resulting from the fertilization of the female egg cell by the male sperm cell. And from the zygote the embryo develops. It is the term used to describe the development of the organism from the fifth to the eight week after fertilization. After that it is called a fetus.

Considering what you know about proteins, why does the "folding" of the protein matter?

Answers

Final answer:

Protein folding is essential for proteins to achieve their functional three-dimensional structures, allowing them to perform specific roles within the cell. Incorrectly folded proteins can lose functionality or cause diseases, highlighting the importance of proper folding and the role of chaperones in this process. Anfinsen's dogma highlights the relationship between amino acid sequence and protein structure.

Explanation:

The folding of a protein is critical to its function because it determines the protein's three-dimensional structure, which in turn influences how the protein interacts with other molecules. Proteins must be folded into their correct shapes to perform their specific functions in the cell, such as catalyzing reactions, signaling, and forming structures. The process of folding involves various forces, including hydrogen bonds and hydrophobic interactions, which help stabilize the protein in its functional conformation. Proteins that do not fold correctly can become dysfunctional or form aggregates that can lead to diseases. Additionally, proteins often receive assistance from chaperones or chaperonins in the folding process to ensure they achieve the correct conformation.

Anfinsen's dogma states that the amino acid sequence of a protein determines its three-dimensional structure. This underscores the importance of protein folding, as even small changes in the amino acid sequence or failure in the folding process can lead to significant functional changes or loss of function. Protecting the correct folding of proteins is crucial for maintaining cellular health and function.

Which plane of dissection would cut through hypochondriac, umbilical, and epigastric abdominopelvic regions all at the same time?

Answers

 Consists of a group of ductless glands that secrete substances called hormones directly into the bloodstream. Hormones are powerful chemical substances that have a profound effect on many body processes such as metabolism, growth and development, reproduction, personality, and the ability of the body to react to stress and disease.

Final answer:

A frontal (coronal) plane would cut through the hypochondriac, umbilical, and epigastric abdominopelvic regions simultaneously, separating the anterior from the posterior portion of the body.

Explanation:

The plane of dissection that would pass through the hypochondriac, umbilical, and epigastric abdominopelvic regions all at the same time is the frontal plane (also known as the coronal plane). This plane separates the front of the body (ventral) from the back (dorsal). In this context, the frontal plane would cut the body in such a way that it passes through these regions vertically, separating the anterior (front) portion from the posterior (back) portion of the body. The hypochondriac region lies below the ribs, the umbilical region surrounds the navel, and the epigastric region is just above the umbilical region. By dissecting along the frontal plane, one would simultaneously pass through all of these specific regions.

Additionally, it is important to understand that other planes such as the midsagittal plane and the transverse plane would not appropriately pass through all the mentioned regions at once. The midsagittal plane divides the body into equal left and right halves and would not traverse the regions horizontally. Meanwhile, the transverse plane divides the body into upper and lower portions, which does not allow it to pass through all three specified regions either.

Which is the best example of competition in a forest ecosystem?

(A) A colony of bees builds and protects a hive together.
(B) Ticks live and feed on deer.
(C) Wolves hunt and eat rabbits.
(D) Blue jays and finches nest in the same oak trees.

Answers

Answer:

The correct answer would be (D) Blue jays and finches nest in the same oak trees.

Competition is a type of ecological relationship between the organisms of the same or different species in which they compete for the same resources.

Limitation of any one resource used by both the organisms would become the limiting factor.  

For example, blue jays and finches depend on the same oak tree for their nesting. Thus, limitation or decrease in the number of oak trees can become the limiting factor.

Answer:

D

Explanation:

True or false. pesticides can be derived from synthetic chemicals and from natural materials.

Answers

True, They can be derived from both~

Where are chromosomes found in an animal cell? A) inside a gene B) in the cytoplasm Eliminate C) in a strand of DNA D) inside of the nucleus

Answers

They are found in the Cytoplasm
It is inside of the nucleus (answer D)

If the speed of the skateboarder at point a is v=1.8m/s, what is her speed at point b? assume that friction is negligible.

Answers

Here,let the speed at B is vfUsing conservation of energy0.5 * m * (vf^2 - v^2) = m * g * (2.7 -1)0.5 * (vf^2 -1.8^2) = 9.8 * (1.7)solving for vfvf = 6.05 m/sthe speed at B is  6.05 m/s
Final answer:

Without more specific information, it's impossible to determine the skateboarder's speed at point B. However, in an ideal physics situation with no external forces (like air resistance), the skateboarder's speed would remain constant at 1.8 m/s.

Explanation:

The problem doesn't provide enough specific information needed to definitively determine the skateboarder's speed at point B. From the given information, we know that the speed of the skateboarder at point A is 1.8 m/s and friction is negligible. But without additional information such as whether the points A and B are at different heights (which would involve potential and kinetic energy changes), or whether some external force acts on the skateboarder between these points, it's impossible to determine the speed at point B.

However, in ideal physics situation where friction, air resistance and other forces are negligible, we can say that, the speed of the skateboarder at point B would remain constant i.e., 1.8 m/s - because in an ideal physics world, without any external forces, an object in motion stays in motion at the same speed and in a straight line.

Learn more about speed here:

https://brainly.com/question/28224010

#SPJ11

Other Questions
Explain how a story about a dog might be an ideal way to explore the theme of how laws work. Include specific examples of dogs' traits and behaviors. Your answer should be at least one hundred and fifty words.What does it by saying the theme of laws? I need to understand that is all. Round 977.259856871 to 3 decimal places Amongst the Mayan peoples, painters were a part of the ____________.a.working classc.ruling classb.slave classd.lower classPlease select the best answer from the choices providedABCD Please Help Me. Use an identity to find the exact value of each expression: Note: You are not allowed to use decimals in your answer. sin(96)cos(264)+cos(96)sin(264)= and sin(258)cos(33)cos(258)sin(33)= Inner-city schools in american continue to have tremendous problems. approximately _____ of the high schools in the united states produce _____ of the country's dropouts. For 15 points The region or area you live today looks nothing like it did when first created. For years man has built new structures or modified the world around us in some way. Choose something around you or somewhere in the world and describe what man has done to modify the area and the change it has brought. (PLEASE HELP!!!)(47 POINTS!!!!!)in one to three paragraphs, compare and contrast the Amy Tan story, Two Kinds and Collier's "Marigolds". Discuss two differences and two similarities. Support your analysis with text evidence and MLA formatting for in text citations. Make one text to self connection about either story. Discuss the major functions of the lymphatic system City of pasadena in california in known for? A train leaves little rock, arkansas, and travels north at 70 kilometers per hour. another train leaves at the same time and travels south at 55 kilometers per hour. how long will it take before they are 375 kilometers apart? Identify the participle in the sentence.The idling engine sound fine to me now._______Is there a business future in manufactured houses, Dad?A: FutureB: IsC: housesD: DadPaying for the flute, Tammy smiled happily and skipped all the way home.A: none of the above B: smiled happilyC: all the way home D: Paying for the flute What specific nutrition guidelines has your school district put in place?Name at least three. Select the correct statement to describe when a sample of liquid water vaporizes into water vapor.A. Temperature decreases and molecular motion increases while shape becomes less defined.B. Temperature decreases and molecular motion decreases while shape becomes more defined.C. Temperature increases and molecular motion decreases while shape becomes more defined.D. Temperature increases and molecular motion increases while shape becomes less defined. Write an equation to represent: four-fifths of z added to six equals eightA) 4/5 z + 6 = 8 B) 4/5 + 6z = 8 C) 4/5 (6)(z) = 8 D) 4/5 (6) + z = 8 A fruit juice container holds 16 servings. If the servings size in 6 ounces, how many ounces does the container hold in all? How does the graph of g(x)=x+7 differ from the graph of f(x)=x?The graph of g(x)=x+7 is the graph of f(x)=x shifted right 7 units.The graph of g(x)=x+7 is the graph of f(x)=x shifted up 7 units.The graph of g(x)=x+7 is the graph of f(x)=x shifted left 7 units.The graph of g(x)=x+7 is the graph of f(x)=x shifted down 7 units. who were the first hominids to walk upright? A. homo erectus B. homo habilis c. Australopithecus d. neanderthals In a cross-country race with a 35 participants, the mean finish time was 21 minutes . Which statement must be true ? Find the total capacity of twenty five containers of cranberry juice if each bottle holds 5 quarts 1 pint 6 oz A) 142 pints 6 oz B) 140 pints 6 oz C) 142 pints 9 oz D) 142 pints 1 pint 6 oz E) None Which is more volatile benzene or toluene? Steam Workshop Downloader