what is the mean of 17, 19, 21, 23

Answers

Answer 1

Answer:

20

Step-by-step explanation:

Answer 2

Answer:

i got 15.5

Step-by-step explanation:


Related Questions


LetterD: is 120 minutes

Answers

Since p = 60 we can plug 60 into the equation.

so instead of (p / 20) x 4 it's (60 / 20) x  4 which equals 12 minutes.

Hope this helped!

John wants to deposit $1000 as a principle amount, with an interest of 4% compounded quarterly. Cayden wants to deposit $1000 as the principle amount, with an interest of 3% compounded monthly. Explain which method results in more money after 5 years. Show all work.

Answers

Answer:

John = $1220.19

Cayden = 1161.62

Step-by-step explanation:

To find how much they'll both get, we can use the formula:

[tex]A=P(1+\dfrac{r}{n})^{nt}[/tex]

First let's start with John.

P = 1000

r = 4% or 0.04

t = 5

n = 4 (Quarterly)

[tex]A=1000(1+\dfrac{0.04}{4})^{4(5)}[/tex]

[tex]A=1000(1+0.01)^{20}[/tex]

[tex]A=1000(1.01)^{20}[/tex]

[tex]A=1220.19[/tex]

Now let's compute for Cayden's.

P = 1000

r = 3% or 0.03

t = 5

n = 12 (Monthly)

[tex]A=1000(1+\dfrac{0.03}{12})^{12(5)}[/tex]

[tex]A=1000(1+0.0025)^{60}[/tex]

[tex]A=1000(1.00.25)^{60}[/tex]

[tex]A=1161.62[/tex]

The monthly compounding gets more yield compared to the quarterly compounding due to the number of times the amount of times it increases per year.

I need help please. 2nd box: meters, cubic meters, or square meters.

Answers

Answer:

I believe it is meters

Step-by-step explanation:

I think so because the rectangle is labeled with meters

To find out area of a rectangle it is (l*w)

In this case it is 9m*7m which is 63 metres squared

Area is 63 metres squared

To find out perimeter of a rectangle we do 2(l*w)

In this case it is (2*9)+(2*7) which is 9+9+7+7=18+14 which is 32

Perimeter is 32 metres


The owner of Cardo Reef Tours found when the price for a tour was $9 US dollars per person
the average number of customers was 1000 per month. When he reduced his price to $7 US dollars
per person the average number of customers increased to 1500 per month. Assuming that his
demand curve was linear, what price should he charge to obtain the largest monthly revenue?
b. If f(x) = 2x
3 − 24x, find the minimum and maximum values of f in the interval [−3,5].

Answers

Answer:

The answers for your two question problem are:

a. He should  charge $7 dollars

b.   Maximum value : f(5) = 130

      Minimum value : f(2) = -32

Step-by-step explanation:

First problem

*When he charges $9 , the numbers of customers are an average of 1000

This means the revenue is

1000*$9  = $9000

*When he charges $7 , the numbers of customers are an average of 1500

This means the revenue is

1500*$7  = $10500

Since

$10500 > $9000

The owner should charge $7, to attract more customers and get higher revenue.

Second problem

f(x) = 2x^3 − 24x

To easily solve this problem, we can graph the equation using a calculator or any plotting tool.

Please, see attached picture

The highest point of the graph, in the interval [-3,5] corresponds to

f(5) = 130

and the lowest point :

f(2) = -32

Mrs. Jackson is covering her bulletin board with new paper. What formula should she use to figure out how much paper to buy?

Answers

Answer: A = L x W

Step-by-step explanation:. Mrs. Jackson should use the formula to calculate area in order to figure out how much paper to buy. The formula is Area = Length x Width. This will tell her exactly how much paper she will need to cover the bulletin board.

Answer:

Step-by-step explanation:

Something of this size could be measured in either ft² or in².

Area of a rectangle is determined by multiplying the width by the height.  In this case the bulletin board will be installed vertically, so let's say that

Area of board = (width)(height)

If, for example, the width were 6 feet and the height 3.5 feet, the area of this board would be (6 ft)(3.5 ft) = 21 ft²

Since 1 ft = 12 in, this 6 foot by 3.5 foot board would be 72 inches by 42 inches.

Multiply: (−4x + 3)(−2x2 − 8x + 2) A) 8x3 − 26x2 − 32x + 6 B) 8x3 + 38x2 + 32x + 6 C) 8x3 + 26x2 − 32x + 6 D) 8x3 − 38x2 + 16x + 6

Answers

Answer:

Your answer is 8x3 + 26x2 − 32x + 6

So it's (c)

Answer: A) 8 x 3 + 26 x 2 − 32 x + 6

Step-by-step explanation:

Find the slope of a line perpendicular to y = 3x + 7

Answers

Answer:

-1/3

Step-by-step explanation:

The slope of the line has the form y = mx + b where m is the slope. Here the slope is m = 3. A line perpendicular to it will have a negative reciprocal slope. The negative reciprocal of 3 is -1/3.

Which is a measure of the efficiency of an investment? A. return rate B. return on investment C. efficiency coefficient

Answers

Answer:

[tex]\bold{Return \ Of \ Investment}[/tex]

Step-by-step explanation:

Return Of Investment: The performance used to evaluate the efficiency of an investment or compare the efficiency of a number of different investments.

       It is a performance level used to compare the efficiency of one investment or more to several or just one more investments. They also evaluate the efficiency of one investment.

Return Of Investment (ROI) is very popular because it is simple, skilled and resourceful. If an investments ROI is net is positive, this tells them that it is worthwhile and has some use to it. If it is low, it lets people know that this is probably not the best solutions, and to not waste their time on something that won't work anyway.

[tex]\boxed{\bold{Mordancy}}[/tex]

Answer: B

Step-by-step explanation:

B. Return on investment .

BEST ANSWER GETS BRAINLIEST For the expression 6 − y + 3, determine the coefficient for the variable term


−1


0


3


6


What is the value of 4 + 5x when x = 3? =


11


12


17


19

Answers

1. The answer would be -1 because the variable term is -y which can also be written as -1y and the coefficient is the number before the variable.

2. The answer would be 19. If you plug 3 into the equation for x you would get 4 + 5(3). Five times three is 15, and 15 plus 4 is 19.

Tom throws a ball into the air. The ball travels on a parabolic path represented by the equation h = -8t 2 + 40t, where h represents the height of the ball above the ground and t represents the time in seconds. The maximum value achieved by the function is represented by the vertex. Use factoring to answer the following:

How many seconds does it take the ball to reach its highest point?

What ordered pair represents the highest point that the ball reaches as it travels through the air?

Hint: because parabolas are symmetric, the vertex of a parabola is halfway between the zeroes of the quadratic.

Answers

Answer:

Time to highest point: 5/2, or 2.5 seconds

Ordered pair: (5/2, 50)

Step-by-step explanation:

Find the vertex of h(t). This will be the highest point of the ball

Find the x coordinate of the vertex with the formula: x = -b/(2a)

x = -40/[2(-8)] = -40/-16 = 5/2

to find the y value, plug 5/2 into the equation and solve

h(5/2) = -8(5/2)² + 40(5/2)

   h(5/2) = -8(25/4) + 200/2

          h(5/2) = -200/4 + 100

             h(5/2) = 50

So the ball reached a maximum height of 50 feet

Final answer:

It takes 2.5 seconds for the ball to reach its highest point. The ordered pair representing the highest point is (2.5, 50), where the ball reaches a height of 50 meters.

Explanation:

The equation h = -8t^2 + 40t describes the height of a ball thrown into the air over time, where h is the height above the ground and t is time in seconds. To find how many seconds it takes for the ball to reach the highest point, we find the time at which the vertex of the parabola occurs since the vertex represents the maximum height.

We know that the ball will reach its highest point halfway between the times when it is at ground level (i.e., when h = 0). Factoring the quadratic equation 0 = -8t^2 + 40t gives us:

0 = t(-8t + 40)

0 = t(0, -8t + 40)

Setting each factor equal to zero gives us two values of t:

t = 0 s (when the ball is first thrown)

-8t + 40 = 0 => t = 5 s (when the ball hits the ground again)

Thus, the time to reach the highest point is halfway between 0 s and 5 s, which is 2.5 seconds.

The ordered pair representing the highest point is found by substituting t = 2.5 s into the original equation:

H = -8(2.5)^2 + 40(2.5)

H = -50 + 100

H = 50 meters.

Therefore, the ordered pair representing the highest point the ball reaches is (2.5, 50).

A recipe calls for of a cup of milk for 10 cookies. How many cups of milk are needed to make 60 cookies?

Answers

Answer: 6 cups of milk

Step-by-step explanation:

1 cup =10 cookies

60 cookies divided 10 cookies= 6cups

Which statement is false?
A. No integers are irrational numbers.
B. All whole numbers are integers.
C. No real numbers are rational numbers.
D. All integers greater than or equal to 0 are whole numbers.

Answers

Irrational numbers just means that it isn’t rational so this means that A is true. If you look up a chart with irrational,rational,real, and integer it will show that all whole numbers are integers so this means B is true. C is false. Same thing about B proves that D is true. SHORT ANSWER: C is false. I hope this helps.

In  the given statement D is false.

What is Rational number ?

In mathematics, a rational number is any number that can be written as a fraction, in which the numerator (the top number) and the denominator (the bottom number) are both integers, and in which the numerator is not equal to zero. In other words which can be written in p/q form.

It is rational to consider integers as rational numbers, not as irrational, because all integers, whether positive or negative, or zero can be written as p/q, for example, 2, 3 and 5 are rational because they can be written as 2/1, 3/1 and 5/1 respectively.

Due to the fact that the rational numbers as well as the irrational numbers can be added together, we can derive real numbers. This means that all real numbers are not rational numbers, since they contain irrational numbers as well.

Hence, the given statement D is false.

Read more about Rational number here :

https://brainly.com/question/24398433

#SPJ2

Andy painted his house he used 1/4 of his paint to paint 5 walls how much paint did he use on the walls if he used the same amount of paint on each wall

Answers

Answer:

1/20 or 0.05 on each wall

Step-by-step explanation:

Answer:

1/20! 1/4 divided by 5 is 1/20.

Step-by-step explanation:

PLEASE HELP ME, im offering 20 points!

Answers

Answer:

this is a whole math test which question do you need help with

Step-by-step explanation:

What percent of the students are part-time students?

Answers

Answer:

The % is 33.3%

Step-by-step explanation:

Due to:

If 600 is the 100%, then 200 what  % is?

600 ---> 100%

200 ---> %?

% = [(200)*(100)]/[600]

% = 33.3%

Best regards

Which of these numbers are irrational?


I just need to know if im right or not Lol

Answers

Answer: The answer is A

You can jog around your block twice and the park once in 10 minutes. You can jog around your block twice and the park 3 times in 22 minutes.

a. Write a system of linear equations that represents this situation.

Let x represent the number of minutes it takes you to jog around your block and y represent the number of minutes it takes you to jog around the park.

What is the system of equations?

Answers

2x + y = 10
2x + 3y = 22

Please consider marking this answer as Brainliest to help me advance, and let me know if you need any clarifications.

H/6-1=-3 solve for H

Answers

Add 1 to both sides

h/6 = -3 + 1

Simplify -3 + 1 to -2

h/6 = -2

Multiply both sides by 6

h = -2 * 6

Simplify 2 * 6 to 12

h = -12

A company produces items in small batches. The machinery needs to warm up before the items can be produced. The scatterplot show the time needed to produce batches of different number of items.

Answers

Answer:

C.

Step-by-step explanation:

The answer is C since the y intercept is 20.

Answer:

Statement C is true.

Step-by-step explanation:

In this question we will go through each statement.

(A). The equipment starts producing items after about 25 minutes of warning up -  False

Because machine takes 20 minutes to produce the items.

(B). Each item requires about 12 minutes of production time - False

(C). The equipment starts producing items after about 20 minutes of warming up - True

(D) Each item requires about 3 minutes of production time. - False

Last summer bills lawn mowing service made a $4,500 profit. This summer his profit was $5,220. What percent increase was this?

20 points
Will mark brainliest
Show work

Answers

Answer:

The percent increase was [tex]16\%[/tex]

Step-by-step explanation:

we know that

Using proportion

Let

x------> the percent increase

[tex]\frac{100\%}{\$4,500}=\frac{x\%}{\$5,220-\$4,500} \\ \\x= 720*100\%/4,500\\ \\x=16\%[/tex]

The profit from Bill's lawn mowing service increased from $4,500 to $5,220, which is a 16 percent increase.

To calculate the percent increase in Bill's lawn mowing service profit, we would subtract the original profit from the new profit and then divide by the original profit. Finally, we multiply by 100 to get the percentage.

Original Profit = $4,500
New Profit = $5,220
Profit Increase = New Profit - Original Profit = $5,220 - $4,500 = $720

Percent Increase = (Profit Increase / Original Profit) x 100
Percent Increase = [tex]\frac{720}{4500}[/tex] x 100
Percent Increase = 0.16 x 100
Percent Increase = 16%

Therefore, the profit increased by 16 percent.

What must be added to x^2+20x to complete the square

Answers

Answer:

(x+10)^2-100

Step-by-step explanation:

Use the formula (b/2)^2 in order to create a new term to complete the square. Hope this helps :)

Sandy mixed 9 ml of an acidic solution with 8 ml of a 42% acidic solution, to make a 45% acidic solution. Find the percent acid concentration of the first solution.

Answers

Answer:

47.67%

Step-by-step explanation:

Amount of 1st solution = 9 ml

Let the percentage acid concentration of 1st solution is x%

Amount of 2nd solution = 8 ml

Percentage acid concentration of 2nd solution = 42%

Percentage acid concentration of the mixture = 45%

Amount of the mixture = 8 + 9 = 17 ml

1st Solution + 2nd Solution = Mixture

x% of 9 ml + 42% of 8 ml = 45% of 17 ml

[tex]0.09x + 3.36 = 7.65\\\\ 0.09x = 7.65 - 3.36\\\\ 0.09x = 4.29\\\\ x = \frac{4.29}{0.09}\\\\ x = 47.67[/tex]

Thus, the percent acid concentration of first solution is 47.67%

need help with this math problem​

Answers

Answer:

x = 6

Step-by-step explanation:

Complementary angles = angles that add up to 90 degrees.

Therefore 8x - 30 + 5x + 42 = 90

13x + 12 = 90

Subtract 12 from both sides and then divide each side by 13.

x = 6

What is the surface area of the cylinder?

Answers

answer is

= 1.312.53 ft²

3 plus two times blank equals 17 what is the blank?

Answers

first 17-3

2×__=14

now divide by 2

__=7

check

3+2×7=17

3+14=17

17=17

Chloe needs 80 hot dogs for her party. If each hot dog package has 8 hot dogs, how many packages of hot dogs does Chloe need to buy?

Answers

Answer:

10 Packages.

Step-by-step explanation:

8 * 10 = 80

Final answer:

To find out how many packages of hot dogs Chloe needs to buy, divide the total number of hot dogs she needs by the number of hot dogs in each package. Chloe needs to buy 10 packages of hot dogs.

Explanation:

To find out how many packages of hot dogs Chloe needs to buy, we need to divide the total number of hot dogs she needs by the number of hot dogs in each package.

80 hot dogs ÷ 8 hot dogs per package = 10 packages

Chloe needs to buy 10 packages of hot dogs.

The figure shows two intersecting lines and the measures of the resulting angles.





What is the value of y?

Answers

Answer:

y= 114

Step-by-step explanation:

1) (4x+ 2x- 12+ 20)=180

First find x (22)

2) (2x+20)+y=180

Plug in x

3) y=114

Final answer:

The values of x and y are 16 and 124 respectively when the angles (4x - 12) and (2x + 20) are vertically opposite and one of these angles forms a linear pair with angle y.

Explanation:

The subject of this question is mathematics, focusing on geometry and algebra. Vertically opposite angles are equal. Hence, (4x-12) = (2x+20). Solving for x, we get x = 16.

Also, it is mentioned that one of the angles forms a linear pair with angle y. A linear pair means that the two angles add up to 180 degrees. So, y + (2x+20) = 180. Substituting x = 16 in this equation and solving for y, we find that y = 124.

Learn more about Vertically opposite angles here:

https://brainly.com/question/30195817

#SPJ2

Which of the following best describes the solution to the system of equations below?
3x + 5y = 9
3x + 5y = 15

Answers

Answer: Option D

Step-by-step explanation:

The equation of the line in slope intercept form is:

[tex]y=mx+b[/tex]

Where m is the slope and b the y-intercept.

Solve for y from both equations:

[tex]5y=-3x+9\\y=\frac{-3}{5}x+\frac{9}{5}[/tex]

[tex]5y=-3x+15\\y=\frac{-3}{5}x+3[/tex]

As you can see, the slopes of the lines are equal, therefore, they are parallel.

If the lines are parallel then the system of equtions has no solution.

Answer:

Choice D  is correct answer.

Step-by-step explanation:

We have given a system of equations.

3x + 5y = 9                             eq(1)

3x + 5y = 15                          eq(2)

We have to find the description of the solution of equations.

y = mx+c is the slope-intercept of equation of line where m is slope and c is y-intercept.

Eq(1) can be written as:

y = -3/5x + 3 where slope is -3/5.

Eq(2) can be written as:

y = -3/5x+5 where slope is -3/5.

Equations with equal slopes are of parallel lines and parallel lines have no solution.Hence, system has no solutions.

Choice D  is correct answer.

Please come answer ASAP!!!
5 - n divided by 3 = 4 what is the value of n?

Answers

Hey there!

The equation we have been given is 5 - n/3 = -4.

Let's start by subtracting 5 from each side.

-n/3 = -9

Multiply each side by 3.

-n = -27

Multiply each side by -1.

n = 27

Check our answer.

5 - 27/3 = -4

5 - 9 = -4

-4 = -4

The value of n is 27.

Hope this helps!

the area of a square garden is 1/36 mi 2 how long is each side

Answers

Answer:

1/6 meters

Step-by-step explanation:

Let the side length be x.

Then the area of the square = x^2

∴ x^2 = 1/36

√(x^2) = √(1^2 / 6^2)

x        = 1/6

Therefore, the side length is 1/6 meters.

Hope it helped you!!!

Other Questions
X-10 explain why mental disorders should be viewed like any other physical illness.why it important not to stigmatize someone with a mental disorders . the point slope form of the equation of a line that passes through (8,4) and (0,2) is y-4=1/4(-8) what is the slope intercept form of the equation for this line. After the gaps between the firm's labor supply and labor demand are identified, a firm should ________. develop and implement action plans conduct a workforce analysis identify its business strategy articulate its talent philosophy and strategic staffing decisions The primary advantage quick-service restaurants have over other restaurant types is URGENT! Which of the following correctly expresses sin(2)sin(6) as a product?Select the correct answer below:2sin(4)cos(2)2sin(2)cos(4)2sin(2)cos(4)2sin(2)sin(4) What are some ideas that i would put for a visual project (power point) on NRA civil rights issues. please idc if you guys get political as long as i can put them in the power point. Identify Cause and Effect How did World War I affect the role of women in society? Subtract 6 ounces from 3 pounds.5 lb., 7 oz.6 lb., 3 oz.2 lb., 10 oz.2 lb., 13 oz. Which type of function is the result of adding a quadratic function and a linear function?A. a linear functionB. a quadratic functionC. a rational functionD. a cubic function PLZ HURRY IT'S URGENT!!!!This is the equation for the formation of sodium chloride from sodium bromide. Cl2 + 2NaBr Br2 + 2NaCl Which are the reactants and the products in this reaction? A. The reactants are Cl2 (chlorine) and NaBr (sodium bromide). The products are Br2 (bromine) and NaCl (sodium chloride). B. The reactants are Br2 (bromine) and NaCl (sodium chloride). The products are Cl2 (chlorine) and NaBr (sodium bromide). C. The reactants are Cl2 (chlorine) and Br2 (bromine). The products are NaBr (sodium bromide) and NaCl (sodium chloride). D. The reactants are NaBr (sodium bromide) and NaCl (sodium chloride). The products are Cl2 (chlorine) and Br2 (bromine). Compro caf en la plaza de comida en Cuba. Yo pago el caf con _____________. (1 point)pesosdlareseurosbolvares Choose the best mode of transportation. Para ir a Panam, debes viajar en _____. carro avin tren taxi Let u= ln x and v=ln y. Write ln(x^3y^2) in terms of u and v. Hey can someone answer this ASAP Select the correct answer. Which European country Established colonial rule in parts of South America? The number of births that occur in a period of time in a given area is called? Birth rate death rate life expectancy During the colonial era, Britains policy of mercantilism primarily affected the economy and commerce of the thirteen colonies. culture and society of the thirteen colonies. religious institutions of the thirteen colonies. politics and government of the thirteen colonies. Help ASAP!!!!!!!!!!!!!!!!!!! If the Laffite family deposits $8500 in savings account at 6.75% interest, compounded continuously, how much will be in the account after 25 years