solve for -6(w+1) < 2(w+5)

Answers

Answer 1

Answer:

Step-by-step explanation:

hello :

-6(w+1) < 2(w+5)

-6w-6< 2w+10

-6w-2w< 6+10

-8w < 16

8w > -16

w > -2


Related Questions

How to write a point slope form of the equation of a line with a slope of -4 and passes through the point (1,6)?

Answers

The point slope form of a line is:
y - y1 = m(x - x1)

The values we have are:
x1 = 1
y1 = 6
m = -4

Plug in the values into the equation
y - 6 = -4(x - 1)

To make into slope form, it is the following:
y - 6 = -4(x - 1)
y - 6 = -4x + 4
y = -4x + 10

Answer:

y-6=-4(x-1)

Step-by-step explanation:

y-y1=m(x-x1)

y-6=-4(x-1)

Solve the equation: x/2-18=(-28)

Answers

Answer:

x = -20

Step-by-step explanation:

First we can rearrange the equation:

[tex]\frac{x}{2}[/tex] -18 = -28

2 * [tex]\frac{x}{2}[/tex] - 18 = -28 * 2

The 2s canel out

x - 36 = - 56

x = -20

The loan that Nate and Isaac got from their parents was at 2% interest for one year. How much will the boys pay in interest on their loan of \$2,500 ? Show your work .

Answers

Answer: they will have to pay 50 dollars

Step-by-step explanation: you have to multiply 2,500 by 0.02 as it is the same as a percent then you should get 50

im really stuck :( can someone please help me ? it would mean a lot

Answers

Answer:

Step-by-step explanation:

Populations is who is surveyed or what the questions is targeting. More specifically who. That would be households with a car.

Use what I put as the definition for population to answer the other questions!

Pam has 24 pencils and 6 erasers. How many times as many pencils as erasers does Pam have?

Answers

Answer:

Pam had 4 times as many pencils as erasers

Step-by-step explanation:

24 pencils

6 erasers

24 pencils = x * 6 erasers

Divide by 6 on both sides to isolate x

x = 4

Pam had 4 times as many pencils as erasers

Hope this helps :)

-3 x [75/(9 - 4)^2]^2 simplify

Answers

Answer:

[tex]-27x[/tex]

Step-by-step explanation:

Given Equation:

                    [tex]-3 x [75/(9 - 4)^2]^2[/tex]

On simplifying the equation:

               [tex]=-3 x [75/(9 - 4)^2]^2\\=-3 x [75/(5)^2]^2\\=-3 x [75/25]^2\\=-3 x [3]^2\\=-3x*9\\=-27x[/tex]

The value of 'x' can be find by equating the simplified value to some certain value according to the equation.

Write an equation to solve for h. Check your answer.
__________________
| |
| | h Area = 96 ft
| | A = bh
----------------------------------
8 ft h = __________

Answers

A/b= h

h=12 ft

Step-by-step explanation:

The formula for area is given as ;

A=b*h

A/b= h .................equation for h

If Area=96 ft²  and b =8 then h=96/8 =12 ft

Learn More

Formula variation ;https://brainly.com/question/10584854

Keywords : equation, solve,

#LearnwithBrainly

The​ _______ represents the number of standard deviations an observation is from the mean.

Answers

Answer:

The z-score represents the number of standard deviations an observation is from the mean.

Step-by-step explanation:

We want to complete the statement:

The _______ represents the number of standard deviations an observation is from the mean.

Whenever we calculate z- scores, we are finding how many standard deviations an observation is from the mean.

A z-score of 3, means an observation is 3 standard deviation above the mean.

Therefore the best complete is:

z-score.

Final answer:

The Z-score represents the number of standard deviations an observation is from the mean. It provides a comparative measure that standardizes data, making it easier to compare data from different sets.

Explanation:

The Z-score represents the number of standard deviations an observation is from the mean. In statistics, it is a way to compare the position of any observation relative to the overall distribution.

Here's an example: if a Z-score of a data point is 2, it means that the data point is 2 standard deviations above the mean. Conversely, if a Z-score of a data point is -1, it means that the data point is 1 standard deviation below the mean.

Z-scores provide a standardized way to interpret data, which makes the comparison of different data sets more straightforward and undistorted by differences in units or scales.

Learn more about Z-score here:

https://brainly.com/question/31613365

#SPJ12

10. Write an equation in slope-intercept form for a line that is perpendicular to the line
y= 2/5x +1

Answers

Step-by-step explanation:

Equation of given line is:

[tex]y = \frac{2}{5} x + 1 \\ equating\: it \: with \: y = m_1x + c, \:we\:find \\ slope \: of \: given \: line \: (m_1 )= \frac{2}{5} \\ y - intercept \: (c) = 1 \\ let \: the \: slope \: of \: required \: line \: be \: m_2. \\ \therefore \: m_1 \times m_2 = - 1..( \because \: lines \: are \: \perp) \\ \therefore \: \frac{2}{5} \times m_2 = - 1 \\ \therefore \:m_2 = - \frac{5}{2} \\ \\ equation \: of \: required \: line \: in \: slope \: \\intercept \: form \: is \: given \: as: \\ y = m_2x + c \\ \huge \orange{ \boxed{\therefore \: y =- \frac{5}{2}x + 1}} \\ [/tex]

Find the coordinates of the reflected image.
A rectangle with vertices L(1, -1), M(1, -9). N(8.-9), and
(8.-1) is reflected over the y-axis.
1.)L'(-1.-1), M'(-1, -9), N'(-8.-9), and 0%(-8, -1)
2.)L (1.-1), M'(1.-9), N'(8.-9), and Oʻ(8.-1)
3.)L'(-1.–1). M?(-9,-1). N'(-9.–8). and O'(-1, -8)
4.)L'(-1. 1). M'(-1.9), N'(-8. 9), and O'(-8.1)​

Answers

Answer:

The actual answer is A or 1 as you have it.

Step-by-step explanation:

All you have to do is just map out the coordinates yourself. You're looking for a reflection that goes across the Y axis, but NOT across the X axis.

Hope this helps you and anyone looking for an answer to their headache.

Final answer:

The reflected coordinates of the rectangle over the y-axis are L'(-1, -1), M'(-1, -9), N'(-8, -9), and O'(-8, -1), matching option 1.

Explanation:

The student is asking about finding the coordinates of a rectangle's vertices after it has been reflected over the y-axis. Reflecting a shape over the y-axis changes the sign of the x-coordinate of each vertex, while the y-coordinate remains the same. So, if we have a point (x, y), the reflected point over the y-axis would be (-x, y). Applying this to the rectangle's vertices we have:

For L(1, -1), the reflection L' would be (-1, -1).

For M(1, -9), the reflection M' would be (-1, -9).

For N(8, -9), the reflection N' would be (-8, -9).

For O(8, -1), the reflection O' would be (-8, -1).

Therefore, the correct reflected coordinates are L'(-1, -1), M'(-1, -9), N'(-8, -9), and O'(-8, -1), which corresponds to option 1.

- Cindy spent $6 on her meal. She spent $4
on a sandwich and the rest on a smoothie.
How many smoothies could be bought
with $124?

Answers

Answer:

She can buy 62 smoothies

Step-by-step explanation:

62 since they cost 2 dollars each divide that by 124 boom

[Question Image Attached] If you are given the graph of g (x) = log 2 x, how could you graph f (x) = log 2 x + 5?

Answers

Answer:

Translate each point of g(x) 5 units up.

Step-by-step explanation:

The given the graph of the parent function

[tex]g(x) = log_{2}(x) [/tex]

We want to use this graph to draw the graph of

[tex]f(x) = log_{2}(x) + 5[/tex]

We can observe that:

[tex]f(x) = g(x) + 5[/tex]

This means the graph of the parent function, g(x) must be shifted up 5 units.

Therefore the correct answer is A.

add blank to each side of x^2-8x=9

Answers

Step-by-step explanation:

To complete the square, take half of the second coefficient, square it, then add the result to both sides.

(-8/2)² = (-4)² = 16

x² − 8x + 16 = 9 + 16

Solving:

(x − 4)² = 25

x − 4 = ±5

x = 4 ± 5

x = -1 or 9

Answer:

part 1: x^2 + -8 x=9

part 2: Add 16 to each side

part 3: (x-4)^2 =25

part 4: -1 and 9

Camacho is buying a monster truck. The price of the truck is xxx dollars, and he also has to pay a 13\%13%13, percent monster truck tax.
Which of the following expressions could represent how much Camacho pays in total for the truck?

Answers

Answer:

Camacho pays in total for the monster truck = $x + $0.13x = $1.13x

Step-by-step explanation:

i.) The price of truck is $x

ii.) Monstor truck tax  = 13% of price of truck = [tex]\frac{13}{100}\times $x[/tex] = $0.13x

iii) Camacho pays in total for the monster truck = $x + $0.13x = $1.13x

Options A and D correctly represent how much Camacho pays in total for the truck:

A. (1 + 0.13)x

D. 1.13x

The total amount Camacho pays for the monster truck includes the price of the truck plus the tax, which is 13% of the price of the truck. Therefore, the total amount can be represented by the expression:

[tex]\[ \text{Total amount} = \text{Price of the truck} + \text{Tax amount} \][/tex]

Given that the price of the truck is x dollars and the tax is 13\% of the price, we can represent the tax amount as 0.13x .

So, the total amount Camacho pays is:

[tex]\[ \text{Total amount} = x + 0.13x \][/tex]

[tex]\[ \text{Total amount} = 1.13x \][/tex]

Therefore, options A and D correctly represent how much Camacho pays in total for the truck:

A. (1 + 0.13)x

D. 1.13x

The complete Question is given below:

Camacho is buying a monster truck. The price of the truck is x dollars, and he also has to pay a 13% monster truck tax. Which of the following expressions could represent how much Camacho pays in total for the truck? Choose 2 answers:

A. (1+0.13)x

B. 13x/100

C. 13x

D. 1.13x

E .13x+x

(12) Geographers use negative numbers to represent points below sea level and positive numbers for points above 1
level. A penguin dove 5 meters below sea level to catch fish for his family, who are sitting on an Iceberg 1 meter above
sea level. What is the difference in elevation between the family and the penguin?
Please!

Answers

Difference in elevation is 6 meters.

Answer: -4

Step-by-step explanation: -5 + 1= -4

Solve this system of equations using the substitution method. If the system of equations
does not have one solution, indicate whether the system has no solution or infinitely
many solutions.
3x+y=5
4x + 2y = 20

Answers

Answer:

well i dont really get ehat yours saying but the qustions are

3x+y=5

3^1+1=5

and then

4z+2y=20

i think

4^6+2^6=20

Step-by-step explanation:

at sal's carshop the salesman make 15 commission on every car they sell. If the dealership buys a car for $16,235 and the salesman sells the car for $22,245 how much is their commission ?

Answers

yea, yea yea yea yea yea yea

The salesman's commission for selling a car at Sal's car shop is $901.50.

To calculate the salesman's commission for selling a car at Sal's car shop, we must first determine the sale price's profit margin over the dealership's purchase price. The profit is found by subtracting the purchase price ($16,235) from the selling price ($22,245).

Profit = Selling Price - Purchase Price
Profit = $22,245 - $16,235
Profit = $6,010

Next, we calculate the commission by taking 15% of the profit:

Commission = Profit * Commission Rate
Commission = $6,010 * 0.15
Commission = $901.50

Therefore, the salesman's commission for selling the car is $901.50.

What is the simplified answer for 8w = 5

Answers

Answer:

w = 5/8

Step-by-step explanation:

divide by 8 to both sides to get 8/8w = 5/8

8/8 = 1, w = 5/8.

Answer:

W= 5/8

Step-by-step explanation:

divide both sides by 8

2) On a map two points are 7cm apart. The map has a scale of 1:10000. Work out the
actual distance. Give your answer in km.

Answers

Answer:

0.7 km

Step-by-step explanation:

Actual distance in cm = 7(10000)

= 70 000 cm

Actual distance in km = 0.7 km

Answer:

0.7

Step-by-step explanation:

the answer for this question someone answer fast pleaseeee​

Answers

Answer:

???

Step-by-step explanation:

you don't have a question to answer

What is 671 divided by 4 with remainders

Answers

Here is how I did it! The “r” means remainder.
Its gonna be 167 with a remainder of 3

A town has a population of 20000 and grows at 6% every year. What will be the population after 6 years to the nearest whole number

Answers

Answer:

27200 rounded will be 30000

Step-by-step explanation:

firstly you find 1% which is 200

then you multiply by 6 to get 6%

then you multiply by 6 again to get the total

What is the algebraic expression for b divided by 9

Answers

Answer:b/9

Step-by-step explanation: the expression b divided by 9 is b/9

Answer: b ÷ 9

Step-by-step explanation:

Well, since the question is to write an expression for b divided by 9, you just write b divided into 9 parts.

NOTE: Remeber, an expression is an equation but WITHOUT an answer.

Hope this helps! Please feel free to correct me if I'm wrong!

What is the solution to this system of equations?

2x - y = 8
x + y = 4
A. (2, -4)
B. (4, 0)
C. (6, 4)
D. (12, -8)

Answers

Answer:

Answer is B. (4,0)

Step-by-step explanation:

2x - y = 8

x + y = 4

solve the equation

2x - y = 8

y = 4 - x

substitute the value of y into the equation

2x - (4 - x) = 8

solve the equation

x = 4

substitute the value of x into an equation

y = 4 - 4

solve the equation

y = 0

answer is (4,0)

sally works 40 hours a week and makes $10 an hour, but her kids are in child care each day, and the day care center charges her $20 per day. If you deduct her childcare expenses, how many dollars per hour does she actually make?

Answers

Answer:

She makes $60 per hour

Step-by-step explanation:

There are 5 days in a week and 40 divided by 5 is 8 and 8x10=80 and 80 subtracted by 20 gives you 60.

Final answer:

After deducting childcare expenses, Sally's actual hourly wage is $7.50 per hour.

Explanation:

The original question is about calculating Sally's actual hourly wage after accounting for childcare expenses. Sally works 40 hours a week and earns $10 per hour. However, she incurs a cost of $20 per day for childcare. Assuming she works 5 days a week, her weekly childcare expenses are $20 x 5 = $100. Therefore, her weekly take-home pay after childcare is (40 hours x $10/hour) - $100 = $400 - $100 = $300. Now, to find Sally's actual hourly wage after childcare expenses, divide her take-home pay by the number of hours worked: $300 / 40 hours = $7.50 per hour.

Beginning from a depth of 35 feet below the surface, a whale swims
upward and jumps to a height of nearly 17 feet above the surface.
a. Model with Math Use an inequality to model the possible change in the number of feet, r, of the whale's elevation.
b. Solve the inequality. Explain the meaning in terms of the situation.​

Answers

a. The inequality that models the possible change in the number of feet, r, of the whale's elevation is: 35 - r ≤ 17.

This inequality represents the starting depth of 35 feet below the surface (35), minus the possible change in elevation (r), which should be less than or equal to the maximum height the whale jumps, which is nearly 17 feet above the surface (17).

b. By solving the inequality 35 - r ≤ 17, we can find the range of possible values for r.

First, subtract 35 from both sides of the inequality: -r ≤ 17 - 35. Simplifying further, we have -r ≤ -18. Then, multiply both sides by -1, remembering to reverse the inequality direction: r ≥ 18.

The solution to the inequality is r ≥ 18, meaning that the possible change in the number of feet of the whale's elevation must be equal to or greater than 18. This implies that the whale's jump cannot be less than 18 feet above the surface.

Therefore, the whale's elevation can change by any value equal to or greater than 18 feet, allowing it to jump to a height of nearly 17 feet above the surface.

for such more questions on inequality

https://brainly.com/question/30238989

#SPJ8

a) The inequality can be written as 35 - r ≤ 17. b) The solution to the inequality is r ≥ 18, which means that the change in the number of feet, r, of the whale's elevation must be greater than or equal to 18.

a.

Since the whale swims upward and jumps to a height of nearly 17 feet above the surface, we can represent the change in elevation as r.

The inequality can be written as:

35 - r ≤ 17

Here, 35 represents the starting depth below the surface, and 17 represents the height above the surface that the whale reaches.

By subtracting r from the starting depth, we account for the possible decrease in elevation as the whale swims upward.

b. To solve the inequality, we can isolate r on one side of the equation:

35 - r ≤ 17

Adding r to both sides of the inequality:

35 - r + r ≤ 17 + r

35 ≤ 17 + r

Subtracting 17 from both sides:

35 - 17 ≤ 17 + r - 17

Simplifying further:

18 ≤ r

Therefore, the solution to the inequality is r ≥ 18.

In terms of the situation, the inequality r ≥ 18 means that the change in the number of feet, r, of the whale's elevation must be greater than or equal to 18.

This indicates that as the whale swims upward and jumps to a height of nearly 17 feet above the surface, the whale's elevation can increase by at least 18 feet from its starting depth of 35 feet below the surface.

Learn more about the inequalities here:

brainly.com/question/20383699

#SPJ4

Charlotte uses a 50% off coupon when she buys a dress the original price of the dress is $45 how much money does Charlotte save by using the coupon​

Answers

Answer: $22.50

Step-by-step explanation:

Since the price is 50% off, you need to find half of 45. 45/2 is 22.5, so she saves $22.50

The dimensions of a box are (x + 1), (4x - 2), and
(3x + 4). What is the volume of the box?

Answers

Answer:

Volume of box = 12x³ + 10x² - 14x - 8

Step-by-step explanation:

Volume of box = Length × Width × Height

Volume of box = (x + 1) (4x - 2) (3x + 4)

Volume of box = (4x² - 2x + 4x - 2) (3x + 4)

Volume of box = (4x² - 2x - 2) (3x + 4)

Volume of box = 12x³ + 10x² - 14x - 8

Answer:

12x^3+22x^2-2x-8

Step-by-step explanation:

i took the test ^^

cotA/tanA simplify each question

Answers

[tex]\bf \cfrac{cot(A)}{tan(A)}\implies \cfrac{~~\frac{1}{tan(A)}~~}{tan(A)}\implies \cfrac{~~\frac{1}{tan(A)}~~}{\frac{tan(A)}{1}}\implies \cfrac{1}{tan(A)}\cdot \cfrac{1}{tan(A)} \\\\\\ \cfrac{1}{[tan(A)]^2}\implies \cfrac{1}{tan^2(A)}\implies \cfrac{1^2}{tan^2(A)}\implies \left( \cfrac{1}{tan(A)} \right)^2\implies cot^2(A)[/tex]

Final answer:

To simplify cotA/tanA, we recognize that cotA is the reciprocal of tanA. The expression simplifies to cosA^2/sinA^2, which can also be written as cotA^2.

Explanation:

To simplify the expression cotA/tanA, we can use the fundamental trigonometric identities that relate the cotangent and tangent functions. The cotangent function, cotA, is the reciprocal of the tangent function, tanA, which means cotA = 1/tanA. Therefore, when we simplify cotA/tanA, we are effectively dividing the reciprocal of the tangent function by the tangent function itself.

The simplification would thus be:

cotA/tanA = (1/tanA)/tanA = 1/(tanA^2)Since tanA = sinA/cosA, the expression can be rewritten as[tex]1/((sinA/cosA)^2)[/tex]Therefore, cotA/tanA simplifies to [tex]cosA^2/sinA^2, or cotA^2.[/tex]

Simplify the radical 147

Answers

Answer and Explanation: The square root of 147 is approximately 12.12436 or 7√3 in radical form. To begin, examine 147's factors. These are: 1, 3, 7, 21, 49, 147.

Hope this helped

Answer:

12.12436 or 7√3

Step-by-step explanation:

Other Questions
During the 1990s worker productivity growth spiked as computers and the internet were introduced to many businesses for the first time. How did this affect the natural unemployment rate? Consider the following statement: "I examined the statistics for our basketball teams wins last year and found that, when the third team played more, the winning margin increased. If the coach played the third team more, we would win by a bigger margin." Evaluate this statement. which lands did the french imperialists claim in 1884 Which link is missing from this food chain?O decomposerO herbivoreo producerO consumer Mauricio, a project manager at a reputed firm, has been assigned to handle a new project that the firm has received. This project involves a lot of scheduling that has to be handled by Mauricio. Mauricio estimates that the first module of the project could be completed in as few as 15 days or could take as many as 25 days, but most likely will require 20 days. Determine the expected task duration. which of the following phrases would represent this expression x/3 3)A triangle has all integer side lengths and two of those sides have lengths 9 and 16. Consider the altitudes to the three sides. What is the largest possible value of the ratio of any two of those altitudes Express your answer as a balanced chemical equation. Identify all of the phases in your answer.1. Li(s)+N2(g)Li3N(s)2. TiCl4(l)+H2O(l)TiO2(s)+HCl(aq)3. NH4NO3(s)N2(g)+O2(g)+H2O(g)4. Ca3P2(s)+H2O(l)Ca(OH)2(aq)+PH3(g)5. Al(OH)3(s)+H2SO4(aq)Al2(SO4)3(aq)+H2O(l)6.AgNO3(aq)+Na2SO4(aq)Ag2SO4(s)+NaNO3(aq)7. C2H5NH2(g)+O2(g)CO2(g)+H2O(g)+N2(g) A single penny is 1.52 mm thick. The distance to the next nearest star other than our own (Alpha Centauri) is 4.22 light-years. If it were possible to stack one mole of pennies, how many times would the stack go between the earth and Alpha Centauri? Use the unit factoring method to determine the answer and show your work. You will need to find or look up the appropriate conversion factors to solve the problem. Your answer should be in scientific notation and have the correct number of significant figures in order to get full credit. (Please note that the text editing functions/buttons below for this essay question allows you to show exponents by using the button show as "x2"in the controls. To use it type the number followed by the exponent such as 104, highlight the 4 and hit the x2 button and you will end up with 104 as the result) Janelle ate 82% of the pie. What fraction of the pie remained On a public ballot, a state legislature places a question relating to legalization of marijuana for medicinal use. In addition, the legislature passes a law that bans corporations from advertising in favor of or opposing the ballot question. The basis for this ban is to ensure that corporations do not have too much influence on the voters. Is the ordinance constitutional?a.Yes, because commercial speech has only partial First Amendment protection.b.No, because it concerns a question on a public ballot.c.Yes, because the government is advancing a substantial government interest.d.No, because the ban includes advertising that may not be protected by the First Amendment.e.No, because the government has banned politically oriented commercial speech. Which of the following is true of both starch and cellulose? a. They are both polymers of glucose. b. They are geometric isomers of each other. c. They can both be digested by humans. d. They are both used for energy storage in plants. e. They are both structural components of the plant cell wall. Jennifer has been diagnosed with spinocerebellar degeneration. The first stage of the disease involves tremors and unsteady gate. In the later stages, she will be unable to stand, walk, and will be uncoordinated in her movements. This disease probably affects the __________ part of the brain.a) hippocampusb) amygdalac) cerebellumd) cerebral cortex How do the underlined words in the passage create meaning? A. They describe how Pau Amma plays. B. They describe how the animals play. C. They describe Pau Ammas impact on the sea and the animals. D. They describe the tasks the Eldest Magician gives to the animals. A paper company needs to ship paper to a large printing business. The paper will be shipped in small boxes and large boxes. Each small box of paper weighs 45 pounds and each large box of paper weighs 80 pounds. There were twice as many large boxes shipped as small boxes shipped and the total weight of all boxes was 1435 pounds. Determine the number of small boxes shipped and the number of large boxes shipped. Based on your understanding of Nectar in a Sieve, what fact would you not select as being accurate? 3x squared minus 7x minus 34 is less than or equal to -10x + 2 Ray Bond sells handcrafted yard decorations at county fairs. The variable cost to make these is $20 each, and he sells them for $50. The cost to rent a booth at the fair is $150. How many of these must Ray sell to break even Which of the following statements is true? Gross private domestic investment less depreciation is net private domestic investment. Gross private domestic investment divided by depreciation is net private domestic investment. Gross private domestic investment plus depreciation is net private domestic investment. Net private domestic investment less depreciation is gross private domestic investment.\ A bacteria culture initially contains 100 cells and grows at a rate proportional to its size. After an hour the population has increased to 380.(a) Find an expression for the number of bacteria after t hours.P(t) Steam Workshop Downloader