A chemist mixes oxygen gas and hydrogen gas to form water, which is composed of one oxygen and two hydrogen atoms per molecule. What has occurred?

Answers

Answer 1
When a chemist mixes oxygen gas and hydrogen gas to form water, which is composed of one oxygen and two hydrogen atoms per molecule. The hydrogen and oxygen atoms bounds together by making a bond called covalent bond. In a covalent bond, two atoms are bound together because they each want to "share" each other's electrons.
Answer 2

Answer:

A chemical change.

Explanation:

I just took the test and got it right.


Related Questions

which best explains why sawdust burns more quickly than a block of wood equal mass under the same conditions

Answers

Because it has less to burn

Sawdust burns more quickly than a block of wood because it has a higher surface area, which allows more oxygen to come into contact with the wood particles and accelerate the combustion reaction. Larger blocks have less surface area exposed to oxygen, so they burn more slowly. High surface area is also the reason why powdered substances, like flour in mills, can be hazardous.

The reason why sawdust burns more quickly than a block of wood of equal mass under the same conditions can be attributed to the difference in surface area. Sawdust consists of tiny particles, each with its own surface exposed to the oxygen in the air. This increased surface area allows for more oxygen molecules to come in contact with the wood particles simultaneously, thus speeding up the combustion reaction.

Larger pieces of wood, such as blocks, have a lower surface area relative to their mass because much of the wood's material is inside the block, where oxygen cannot easily reach. As a result, the reaction takes place more slowly. When more surface is exposed, as with sawdust, there is a greater likelihood for the wood particles to come in contact with the oxygen required for burning, leading to a faster reaction rate.

Examples of this can be seen when starting a fire; kindling with a high surface area is used to initiate the fire due to its ability to burn more rapidly. Additionally, this principle demonstrates why powdered substances can be more hazardous, as seen in the explosion risk in flour mills, where flour particles have a high surface area.

What's the primary difference between a scientific theory and a scientific law , is that a law?

Answers

In general, a scientific law is the description of an observed phenomenon. It doesn't explain why the phenomenon exists or what causes it. The explanation of a phenomenon is called a scientific theory. It is a misconception that theories turn into laws with enough research


From Google.

It explains why some physical phenomenon behaves as they do.

[03.04]When one atom of potassium (K) combines with one atom of fluorine (F), an ionic bond forms, resulting in potassium fluoride (KF). Which of the following describes the arrangement of valence electrons in a bond between K and F?

The valence electrons are shared equally between K and F.
The valence electrons spend more time around the atom of K.
The valence electrons spend more time around the atom of F.
The valence electrons are given up by the K and gained by the F.

Answers

Heyo, I believe that the answer would be D. The valence electrons are given up by the K and gained by the F.
Final answer:

The valence electrons are transferred from the potassium atom to the fluorine atom, resulting in the formation of an ionic bond in potassium fluoride (KF), with potassium becoming a cation and fluorine becoming an anion.

Explanation:

When one atom of potassium (K) combines with one atom of fluorine (F), an ionic bond forms, resulting in potassium fluoride (KF). In this process, the valence electrons are not shared equally between K and F, nor do they spend more time around the atom of K. Instead, the valence electrons are transferred from the potassium atom to the fluorine atom, due to the difference in electronegativity between the two elements. Potassium, which has just one electron in its valence shell, easily donates this electron, becoming a positively charged ion, or cation. Fluorine, which has seven electrons in its valence shell, gladly accepts this electron to complete its octet, becoming a negatively charged ion, or anion, as a result.

Convert 30 g/L to the unit g/mL.
A) 30,000 g/mL
B) 300 g m/L
C) 0.03 g/mL
D) 0.0003 g/mL

Answers

It's A, just do conversion factors to find the end, mL





Calculate the standard free-energy change for the following reaction at 25 °C. Standard reduction potentials can be found here.

Answers

Since there are no given data for us to solve this problem, I will explain what a Standard Reduction Potential is. For example, if a student had an experiment and he wanted to know what is the most efficient and powerful redox reaction involving an uncommon combination of chemicals. The student would most likely record information in the Standard Reduction Potential that showed the voltage generated by the reaction in Aqueous Solution at 25 degrees Celsius and 1 atmosphere. This is a list of half reaction of ions in the solution at standard temperature and pressure.

What is the name of this molecule?

CH2 - CH2 - CH3
|
CH3 - CH2 - CH - CH2 - CH = CH3

Answers

It is a linear chain.

It has one double bond, so it is an alkene

It has 9 carbon atoms, so it is a nonene.

Number the carbons so that the double bond is the closer to the first carbon.

As the double bond is in the first carbon, you name it 1-nonene.

Answer: 1-nonene

What is true about the elements of a period? They have the same number of electron shells. They have similar chemical characteristics. They have similar physical characteristics. They transition from a metal to nonmetal to inert gas from left to right.

Answers

the first and the last statement are correct

Answer:

They have the same number of electron shells, and they transition from a metal to nonmetal to inert gas from left to right.

1. Ernest Rutherford discovery of radioactivity 2. James Chadwick discovery of the electron 3. Henri Becquerel discovery of the neutron 4. J.J. Thomson discovery of the atomic nucleus

Answers

You must match each scientist with its major contribution to science.

Scientist                

1.Ernest Rutherford

2. James Chadwick

3. Henri Becquerel

4. J.J. Thomshon

Contribution

a) Discovery of radiactivity

b) Discovery of the electron

c) Discovery of neutron

d) Discovery of atomic nucleus


Answers

1 - d: Ernest Rutherford discovered the atomic nucleous

This was the result of the experiment of the gold  foil experiment.

2 - c: James Chadwick discovered the neutron

This was in 1932. James Chadwick was a collaborator of Ernest Rutherford.

3 - a: Henri Becquerel discovered the radiactivity.

That is why the unit of radioactivity is called the becquerel.

4 -b: J.J Thompson discovered the electron

J.J Thompson's cathode ray tube experiments led him to conclude the existence of an under atomic particle named the electron

Answer:

1. Ernerst Rutherford =====> Discovery of Atomic Nucleus

2. James Chadwick =====> Discovery of Neutron

3. Henri Becquerel =====> Discovery of Radioactivity

4. J.J. Thomson =====> Discovery of Electron

Explanation:

Antimony (III) sulfide is reacted with excess iron. If 175.6 grams of pure antimony is produced, what mass of antimony (III) sulfide was required to start with? Sb2S3(s) + 3Fe(s)→2Sb(s) +3FeS(s)

Answers

The balanced chemical reaction is:

Sb2S3(s) + 3Fe(s) → 2Sb(s) +3FeS(s)

We are given the amount of pure antimony that is to be produced from the reaction. Since the amount of iron is in excess, then what is important is the amount of the antimony sulfide that is to be supplied to produce the given amount of antimony. We relate the substances by the use of the reaction after converting the mass to units of moles. We calculate as follows:

175.6 g Sb ( 1 mol Sb / 121.76 g Sb ) ( 1 mol Sb2S3 / 2 mol Sb ) ( 339. 37 g / mol ) = 244.95 g Sb2S3

Therefore, approximately 245 g of Sb2S3 should be supplied to the reaction.

A prairie dog runs into its burrow as a coyote approaches.This behavior helps the prairie dog

Answers

This behavior helps the prairie dog from being prey upon by coyote.
Prairie dogs live in burrow and they normally do not move much away from their burrows. When they sense danger they will dash quickly back into their burrows. This behavioral adaptation protect them from predators.

Answer:

sample response:  Prairie dogs create a safe home for their young by creating underground burrows, which protect them from hailstorms, blizzards, floods, droughts, and fires. The burrow contains many different chambers, including a nursery that is very deep underground. This protects the young from predators as well as changes in the temperature outside. The burrows even include observation posts where they can watch for predators.

Explanation:

which of the following would you list under cash inflow in a financial plan

Answers

you recived t bonus at work
Final answer:

In a financial plan, cash inflows represent the sources of revenue or capital coming into the business. This could be from sale of products or services, investment income, funds raised from investors or loans, or reinvested profits.

Explanation:

In a financial plan, cash inflows represent the sources of revenue earned by the business. Such cash inflows could be listed as follows:

Sale proceeds from goods or services: This makes up the operating revenue for businesses. Investment income: if the firm has made investments, then the income from these investments such as interest, dividends, or returns would be considered a cash inflow. Funds raised from early-stage investors, loans from banks or bonds, or by selling stock would also get listed under cash inflow as they represent capital coming into the firm. Reinvested profits, while they're not fresh cash coming in, represent an internal cash inflow, repurposing earned money for further business growth

Under cash flows, we focus primarily on the channels that bring cash into the organization.

Learn more about Cash Inflows here:

https://brainly.com/question/10714011

#SPJ2

1.What does the Law of Conservation of Energy tells us?

2.Give an example of 1 way that heat is transferred in your home by conduction, convection and radiation.

3.What is the difference between renewable and nonrenewable resources?

4. Energyville has run out of fossil fuels and is in an energy crisis.  What is one type of renewable energy source that you might recommend to the mayor of Energyville and why do you think that it should be considered?

5. Develop an action plan that includes one specific way that you can conserve energy in your own home.

Answers

1. Energy can neither be created or destroyed.
2. Conduction. Putting a pot of water on a hot burner. Convection. Putting your wet shoes over an air vent to dry them quicker. Radiation. Sitting in front of the fire to warm your hands up.
3. renewable sources can be used again and again, but non renewable sources cannot.
4. I would recommend solar energy. I think solar energy should be considered because solar energy can be reused, and also because they can use it to power their houses and they wouldn't need fossil fuels to do so.
5. Turn off the lights and open the windows during the day and if something is left plugged into the wall and it is not being used, unplug it.

hope I could help!

Final answer:

The Law of Conservation of Energy highlights the transformation, not the depletion, of energy. In homes, heat transfers via conduction, convection, and radiation. Solar energy is advised for Energyville for its renewable qualities, while swapping to LED lights at home conserves energy.

Explanation:

The Law of Conservation of Energy teaches us that energy cannot be created or destroyed, only transformed from one form to another. This principle is fundamental in understanding how energy interacts and transforms in the universe.

Conduction: Heat moving through the walls of your house.

Convection: Warm air circulating inside a room.

Radiation: Heat from the sun warming your home's surfaces.

Renewable vs Nonrenewable Resources: Renewable resources, such as solar and wind, can be replenished over time and have lower environmental impacts, whereas nonrenewable resources, like coal and oil, are finite and typically more polluting.

For Energyville, I recommend solar energy as a renewable source due to its accessibility, decreasing cost, and low environmental impact compared to other energy sources.

One way to conserve energy at home is to replace incandescent bulbs with LED lights, which use less energy and last longer, significantly reducing energy consumption and costs.

How many moles of KMnO4 can be produced from 0.886 moles of carbon dioxide?

Answers

To answer this problem, you must refer to a chemical reaction. The use of Carbon Dioxide to yield Potassium Permanganate undergoes a reaction shown in the picture. Through stoichiometric calculations, you can answer the problem as follows:

0.866 mol CO2 * (2 mol KMnO4/ 10 mol CO2) = 0.1732 mol KMNO4


Answer:

2.48

Explanation:

A scientist wished to carry out a chemical reaction in which two moles of aluminum combine with three moles of sulfur. He has 2.70 g of aluminum to react. How many grams of sulfur must he take to satisfy all the aluminum atoms?

1.51 g
2.14 g
3.41 g
4.81 g

Answers

4. (81 g) is the correct answer

Answer : The correct option is, 4.81 g

Explanation : Given,

Mass of aluminium = 2.70 g

Molar mass of aluminium = 26.98 g/mole

Molar mass of sulfur = 32.07 g/mole

First we have to calculate the moles of aluminium.

[tex]\text{Moles of Al}=\frac{\text{Mass of Al}}{\text{Molar mass of Al}}=\frac{2.7g}{26.98g/mole}=0.1mole[/tex]

Now we have to calculate the moles of sulfur.

According to the question,

As, 2 moles of aluminium react with 3 moles of sulfur

So, 0.1 mole of aluminium react with [tex]\frac{3}{2}\times 0.1=0.15mole[/tex] of sulfur

Now we have to calculate the mass of sulfur.

[tex]\text{Mass of sulfur}=\text{Moles of sulfur}\times \text{Molar mass of sulfur}[/tex]

[tex]\text{Mass of sulfur}=0.15mole\times 32.07g/mole=4.81g[/tex]

Therefore, the mass of sulfur he take must be, 4.81 g

Consider the reaction below. C2H4(g) + H2(g) to C2H6(g) Which change would likely cause the greatest increase in the rate of the reaction?
a decrease temperature and decrease pressure
b increase temperature and decrease pressure
c decrease temperature and increase pressure
d increase temperature and increase pressure

Answers

D. Increase temperature and increase pressure

Answer: Option (d) is the correct answer.

Explanation:

In the given reaction, [tex]C_{2}H_{4}(g) + H_{2}(g) \rightarrow C_{2}H_{6}(g)[/tex] greatest increase in rate of reaction only occur when we increase the temperature and also increase the pressure.

This is because increase in pressure will bring the molecules closer to each other whereas increase in temperature will help in more number of collisions between reactant molecules.

Thus, this will lead to increase in formation of products. Hence, we can conclude that rate of reaction will increase with increase in temperature and increase in pressure.

15) Which of the these is a balanced chemical equation?
A) CO(g) + O2(g) → CO2(g)
B) CO(g) + 2O2(g) → 2CO2(g)
C) 2CO(g) + O2(g) → 2CO2(g)
D) 2CO(g) + 2O2(g) → 2CO2(g)

Answers

The correct answer is C.

On the left:
2 carbon+ 2 oxygen+ 2 oxygen

On the right:
2 carbon+ 4 oxygen (remember to multiply the coefficient and subscript)

Answer:

c

Explanation:

What is the value of in a spontaneous reaction?

Answers

The direction of spontaneous change is the direction in which total entropy increases. Total entropy change, also called the entropy change of the universe, is the sum of the entropy change of a system and of its surroundings

when hydrogen peroxide bubbles, it is undergoing a chemical change. which statement best describes what is happening?

Answers

It is going through the process of decomposition. The solution has weaker bonds than would be necessary to keep it together given the outside conditions, causing the bonds to break and the bubbles are oxygen bubbles escaping the solution.

Anouk does 150 J of work using a hammer to pull a nail out of a piece of wood, and the hammer does 105 J of work on the nail. What is the efficiency of the hammer? 1.4% 7% 70% 143%

Answers

Answer:

70%

Explanation:

105 divided by 150 equal to 0.7.  then u multiply 0.7 by 100. equal 70.  so its C because efficiency = (effective work)/(executed work) * 100%

hope it helped :3

Answer:

70%

Explanation:

105 divided by 150 equal to 0.7.  then u multiply 0.7 by 100. equal 70.  so its C because efficiency = (effective work)/(executed work) * 100%

Which of the following is the weakest? A. hydrogen bond B. polar covalent bond C. dipole interaction D. ionic bond

Answers

The answer is A. Hydrogen bond

Molecules that have nonpolar covalent bonds donot form hydrogen bonds. Strenght. Hydrogen bonds are classified as weak bonds because they are easily and rapidly formed and broken under normal biological conditions.

Hope I helped :)

-Bucky

How many moles of Mg(OH)2 are needed to completely neutralize 2.48 mol HNO3

Answers

the answer is  1.24  mol Mg(OH)2

The required moles of Mg(OH)₂ that are needed to completely neutralize 2.48 mol of HNO₃ is 1.24 moles.

What is the stoichiometry?

Stoichiometry of the reaction gives idea about the relative amount of moles of reactants and products present in the given chemical reaction.

Given chemical reaction is:

Mg(OH)₂ + 2HNO₃ → Mg(NO₃)₂ + 2H₂O

From the stoichiometry of the reaction, it is clear that:

2 moles of HNO₃ = reacts with 1 moles of Mg(OH)₂

2.48 moles of HNO₃ = reacts with (1/2)(2.48)=1.24 moles of Mg(OH)₂

Hence required moles of Mg(OH)₂ is 1.24mol.

To know more about stoichiometry, visit the below link:

https://brainly.com/question/14935523

#SPJ2

The phase change in which a substance changes from a liquid to a solid is A. freezing. B. melting. C. sublimation. D. condensation.

Answers

freezing. Think of what happens when you put water in the freezer

Why are p waves called push-pull waves?

Answers

P waves are called push-pull waves because they move along a horizontal path. As they do this, they expand and contract material.
Answer;

Because they move in a horizontal path

Explanation;P waves or the primary waves are the first waves to arrive during an earthquake. They are the fastest waves created by an earthquake.P waves travel through the interior of the earth and an pass through both solid and molten rock. These waves are also known as compressional waves due to their pulling and pushing. When particles are subjected to a P wave they move in the same direction as the wave motion which is the direction of energy travel.

When Gerald mixes baking soda and vinegar, the materials combine to turn into a gas. What can Gerald assume occurred?

Answers

i am not explaining step by step so the answer is straight to the point. sorry i fyou wanted if an explanation.

THE ANSWER IS:    A.) CHEMICAL CHANGE

When Gerald mixes baking soda and vinegar, the materials combine to turn into a gas. Its a type of chemical change.

What is chemical change?

Chemical synthesis, and, alternatively, chemical breakdown into two or more separate molecules, occurs when one material reacts with another to create a new substance. These processes have been referred to as chemical change, and they are typically irreversible barring additional chemical reactions.

What is baking soda?

The organic compounds sodium bicarbonate, also referred to as baking soda and bicarbonate of soda, have the formula [tex]NaHCO_{3}[/tex] . That is a salt made up of the cation sodium and the anion bicarbonate. Sodium bicarbonate ( [tex]NaHCO_{3}[/tex] ) would be a white, crystalline substance that frequently takes the form of a fine powder.

Now, it is found that when Gerald mixes baking soda and vinegar, the materials combine to turn into a gas is a kind of chemical change.

To know more about chemical change and baking soda

https://brainly.com/question/23693316

#SPJ2

Which of the following is an example of applied research? Determining the components of the human genome. Studying the behavior of gorillas when raising their offspring. Finding replacement chemicals for the air-polluting chlorofluorocarbons used in machines and appliances. Working with carbon to determine its bonding characteristics.

Answers

C. Finding replacement chemicals for the air-polluting
chlorofluorocarbons used in machines and appliances is the answer. Applied research requires solving everyday problems with the environment. This answer does just that!

Answer:

Finding replacement chemicals for the air-polluting chlorofluorocarbons used in machines and appliances.

Explanation:

Applied research refers to research targeted at solving a specific problem in the society. Simply put, it is a research that focuses on bringing solution to practical problems in the society.

Chloroflourocarbons(CFCs) are known to cause damage to the ozone layer. Hence any research aimed at its substitution is targeted at solving a practical problem in the society hence it is an applied research.

An s sublevel is represented by the quantum number

Answers

Each sublevel is given a certain quantum number from 0 till 3 according to its order.

Since s is the first sublevel, therefore, it has quantum number l=0.
(p has l=1, d has l=2 and f has l=3).

Sublevel s can hold up to two electrons only.

which of the following materials is necessary to stop a beta particle

Answers

The material needed to stop a beta particle is c. thin pieces of wood.

Which of these is a major source of organic compounds? petroleum coal natural gas all of these

Answers

youre answer is all of the above because they all work

Answer: The correct answer is all of these.

Explanation:

Organic compounds are defined as the chemical compounds where one or more carbon atoms are covalently bonded to other atoms of hydrogen, oxygen or nitrogen.

They occur naturally in nature and the main sources of these organic compounds are petroleum, coal and natural gases.

Petroleum are the naturally occurring substances which contain organic compounds in the form of gases, liquid or semi-solid. Thus, they are a major source of organic compound.

Coal is also a form of fossil fuel which are the major source of organic compound.

Natural gas contains hydrocarbons and also is the major source of organic compounds.

Thus, the correct answer is all of these.

Liquid nitrogen has different properties from gaseous nitrogen. Is it a chemical change when liquid nitrogen warms to gaseous nitrogen?

Answers

No it is physical I think

Answer:

No, because the different properties are physical while the chemical properties remain the same.

Explanation:

Which of the following is the correct name for the compound MgBr2

Answers

Magnesium and 2 broumim

Answer : The correct name for the compound [tex]MgBr_2[/tex] is, Magnesium bromide.

Explanation :

Ionic compound : It is defined as the compound which is formed when electron gets transferred from one atom to another atom.

Ionic compound are usually formed when a metal reacts with a non-metal.

The rules for naming the ionic compounds is given as :

The positive ion (cation) is named first.The negative ion (anion) is named next.The suffix is added at the end of the negative ion (anion). The suffix used is '-ide'.

Hence, the correct name for the compound [tex]MgBr_2[/tex] is, Magnesium bromide.

Other Questions
Researchers who share the same idea as sigmund freud regarding aggression believe that it is: A student nurse looks at a patients chart and does not understand the meaning of serious sleep apnea, so she asks the head nurse for assistance. how might the head nurse describe this condition? Evaluate f(x) when x=9 Question 4(Multiple Choice Worth 5 points)(05.03 MC)A graph is shown below:A graph is shown. The values on the x axis are 0, 3, 6, 9, 12, and 15. The values on the y axis are 0, 9, 18, 27, 36, and 45. Points are shown on ordered pairs 0, 36 and 3, 27 and 6, 18 and 9, 9 and 12, 0. These points are connected by a lineWhat is the equation of the line in slope-intercept form? y = 36x 3 y = 3x + 36 y = 3x + 12 y = 12x + 3 The model of monopolistic competition characterizes the market for plumbing services in a city. suppose that the market is in long-run equilibrium. for a typical plumbing firm, price: which statement best describes the consequences of european plantation owners brutal treatment of their african slaves in the americas The ______ operator always follows the cin object, and the ______ operator follows the cout 44 object. What does a perceived lack of ability to influence government and politics reflect? What is the equation of the line? When joe thinks about his sorely missed girlfriend, he drinks alcohol, which helps dull his feelings. this best illustrates:? Can someone help me The longest straight line that can be drawn to connect two point on the circumference of a circle whose radius is 9 inches is Find the angle between the given vectors to the nearest tenth of a degree. u = , v = Explain why increased ecosystem diversity contributes to increased biodiversity in the biosphere answer The valve seat performs two functions: It provides a seal for the valve in the combustion chamber, and it provides a cool surface to carry heat away from the valve. Most valves use a _______-degree seating angle. A. 30 B. 60 C. 45 D. 15 How did William Penn's treatment of Native Americans differ from the Puritans' treatment? A. Penn treated native people with respect and paid a fair price for their land. B. Penn enslaved local native people. C. Penn ignored the native people unless they interfered with colonial goals. D. Penn offered to make native people full citizens with voting rights. Today, sociologists tend to study religion from a ____________ perspective. this allows them to look at everyday human interactions, practices, and beliefs on a small scale. A restaurant catered a party for 40 people. A childs dinner (c) cost $11 and an adults dinner (a) cost $20. The total cost of the dinner was $728. How many children and adults were at the party? Use the table to guess and check.8 children and 32 adults9 children and 31 adults10 children and 30 adults12 children and 28 adults Si ests de vacaciones y te quedas en un hotel, cules son todas las cosas que se encuentran en la habitacin? las sbanasuna marquesinauna colchael jabnlas toallasuna pista de baileuna almohada Which executive department is responsible for managing public lands and national parks ?